
CAS Number882-59-7
Synonyms2,2-diphenyl-oxirane; 2,2-Diphenyloxiran; 1,1-diphenyl-1,2-epoxyethane; 1,1-diphenyl oxirane; MFCD00040725; EINECS 212-929-0; 1,1-Diphenyl-ethylene oxide; diphenyloxirane; Oxirane,2,2-diphenyl
Molecular FormulaC14H12O1
Molecular Weight196.25
Purity95%
Density1.147 g/cm3
Boiling Point305ºC at 760 mmHg
Melting Point54-56ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 882-59-7 |
| Catalog No. | 2A-9000643 |
| Chinese Name | 1,1-二苯基环氧乙烷 |
| Synonyms | 2,2-diphenyl-oxirane; 2,2-Diphenyloxiran; 1,1-diphenyl-1,2-epoxyethane; 1,1-diphenyl oxirane; MFCD00040725; EINECS 212-929-0; 1,1-Diphenyl-ethylene oxide; diphenyloxirane; Oxirane,2,2-diphenyl |
| Molecular Formula | C14H12O1 |
| Molecular Weight | 196.25 |
| Purity | 95 |
| Density | 1.147 g/cm3 |
| Boiling Point | 305ºC at 760 mmHg |
| Melting Point | 54-56ºC |
| Storage Condition | Flammables area |
| HTC | 2910900090 |
| MDL Number | MFCD00040725 |
| SMILES | c1ccc(C2(c3ccccc3)CO2)cc1 |
| InChI | InChI=1S/C14H12O/c1-3-7-12(8-4-1)14(11-15-14)13-9-5-2-6-10-13/h1-10H,11H2 |
| InChI Key | PRLJMHVNHLTQJJ-UHFFFAOYSA-N |
| MSDS | msds/643_1_882_59_7.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 5.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2910900090. epoxides, epoxyalcohols, epoxyphenols and epoxyethers, with a three-membered ring, and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1,1-Dichloroethane | 75-34-3 | 2A-0201633 |
| 1,1-Difluorocyclopentane | 1120-70-3 | 2A-9000638 |
| 1,1-Dimethoxypropan-2-one | 6342-56-9 | 2A-9000639 |
| 1,1-Dimethylthio-2-nitroethylene | 13623-94-4 | 2A-9000640 |
| 1,1-Diphenylethyl cyanide | 5558-67-8 | 2A-9000642 |
| 1,1-Diphenylhydrazine hydrochloride | 530-47-2 | 2A-9000644 |
| 1,2,2,6,6-Pentamethyl-4-piperidinol | 2403-89-6 | 2A-9000645 |
| 1,2,3,4,5,6,7,8-Octahydroacridine | 1658-08-8 | 2A-9000646 |
| 1,2,3,4,6-Penta-O-acetyl-beta-D-galactopyranose | 4163-60-4 | 2A-9000647 |
| 1,2,3,4-Tetrafluorobenzene | 551-62-2 | 2A-9000648 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA