
CAS Number31545-26-3
SynonymsEINECS 250-690-4; (4-Chlor-3-nitrophenyl)-cyclopropylketon; 4-Chloro-3-nitrophenyl cyclopropyl ketone; (4-Chloro-3-nitrophenyl)(cyclopropyl)methanone
Molecular FormulaC10H8ClNO3
Molecular Weight529.98
Density1.464g/cm3
Boiling Point333.4ºC at 760mmHg
Melting Point78-80ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 31545-26-3 |
| Catalog No. | 2A-9063475 |
| Chinese Name | 4-氯-3-硝基苯环丙烷甲酮 |
| Synonyms | EINECS 250-690-4; (4-Chlor-3-nitrophenyl)-cyclopropylketon; 4-Chloro-3-nitrophenyl cyclopropyl ketone; (4-Chloro-3-nitrophenyl)(cyclopropyl)methanone |
| Molecular Formula | C10H8ClNO3 |
| Molecular Weight | 529.98 |
| Density | 1.464g/cm3 |
| Boiling Point | 333.4ºC at 760mmHg |
| Melting Point | 78-80ºC |
| Storage Condition | Sealed in a cool, dry environment at 0-6 ºC |
| HTC | 2914700090 |
| MDL Number | C25H26ClF2N7O2 |
| SMILES | O=C(c1ccc(Cl)c([N+](=O)[O-])c1)C1CC1 |
| InChI | InChI=1S/C10H8ClNO3/c11-8-4-3-7(5-9(8)12(14)15)10(13)6-1-2-6/h3-6H,1-2H2 |
| InChI Key | UISHBVQQPVMSCS-UHFFFAOYSA-N |
| MSDS | msds/63475_1_31545_26_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Cyclohex-2-enamine | 1541-25-9 | 2A-9063463 |
| 2-Butanone, 3,4-dibromo-4-phenyl- | 6310-44-7 | 2A-9063464 |
| 3-Buten-2-one, 3-bromo-4-phenyl- | 31207-17-7 | 2A-9063465 |
| Cyclopentanone, 2-(1,1-dimethylpropyl)- | 25184-25-2 | 2A-9063466 |
| Cyclopentanone, 2-(1,1-dimethylethyl)- | 40557-24-2 | 2A-9063471 |
| Methyl hydrogen succinate | 3878-55-5 | 2A-9063477 |
| Cyclopentanone, 2-(1-methylethyl)- | 14845-55-7 | 2A-9063478 |
| (3-Amino-4-chlorophenyl)(cyclopropyl)methanone | 57189-92-1 | 2A-9063479 |
| Cyclohexanone, 2-(1,1-dimethylethyl)- | 1728-46-7 | 2A-9063485 |
| 3,4-Dihydro-1-[(4-methoxyphenyl)methyl]-1H-1,4-Benzodiazepine-2,5-dione | 169504-53-4 | 2A-9063488 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA