
CAS Number6310-44-7
Synonyms3,4-dibromo-4-phenyl-2-butanone; 3,4-dibromo-4-phenyl butane-2-one; 3,4-dibromo-4-phenyl-butan-2-one; 3,4-Dibrom-4-phenyl-butan-2-on; Benzylidenaceton-dibromid
Molecular FormulaC10H10Br2O
Molecular Weight305.999
Density1.701g/cm3
Boiling Point304.1ºC at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 6310-44-7 |
| Catalog No. | 2A-9063464 |
| Chinese Name | 3,4-二溴-4-苯基-2-丁酮 |
| Synonyms | 3,4-dibromo-4-phenyl-2-butanone; 3,4-dibromo-4-phenyl butane-2-one; 3,4-dibromo-4-phenyl-butan-2-one; 3,4-Dibrom-4-phenyl-butan-2-on; Benzylidenaceton-dibromid |
| Molecular Formula | C10H10Br2O |
| Molecular Weight | 305.999 |
| Density | 1.701g/cm3 |
| Boiling Point | 304.1ºC at 760 mmHg |
| HTC | 2914700090 |
| MDL Number | MFCD00085596 |
| SMILES | CC(=O)C(Br)C(Br)c1ccccc1 |
| InChI | InChI=1S/C10H10Br2O/c1-7(13)9(11)10(12)8-5-3-2-4-6-8/h2-6,9-10H,1H3 |
| InChI Key | DQQMRIMUYWACAY-UHFFFAOYSA-N |
| MSDS | msds/63464_1_6310_44_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1,2,3-Oxadiazolidin-5-one, 3-phenyl- | 412301-47-4 | 2A-9063454 |
| Pentanoic acid, 2-hydroxy-4-oxo- | 54031-97-9 | 2A-9063455 |
| Propionitrile, b,b'-iminodi- | 111-94-4 | 2A-9063457 |
| Tricyclo[2.2.1.02,6]heptan-3-one | 695-05-6 | 2A-9063461 |
| Cyclohex-2-enamine | 1541-25-9 | 2A-9063463 |
| 3-Buten-2-one, 3-bromo-4-phenyl- | 31207-17-7 | 2A-9063465 |
| Cyclopentanone, 2-(1,1-dimethylpropyl)- | 25184-25-2 | 2A-9063466 |
| Cyclopentanone, 2-(1,1-dimethylethyl)- | 40557-24-2 | 2A-9063471 |
| (4-Chloro-3-nitrophenyl)(cyclopropyl)methanone | 31545-26-3 | 2A-9063475 |
| Methyl hydrogen succinate | 3878-55-5 | 2A-9063477 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA