
CAS Number52962-26-2
Synonyms3-(o-carboxyphenyl)pentane-2,4-dione; 2-<1-Acetyl-2-oxo-propyl>-benzoesaeure; 2-Diacetylmethyl-benzoesaeure; 3-(2-Carboxy-phenyl)-pentandion-(2.4); 3-(2-Carboxyphenyl)pentane-2,4-dione; 2-(1-acetyl-2-oxo-propyl)-benzoic acid; ms-(2-Carboxy-phenyl)-acetylaceton
Molecular FormulaC12H12O4
Molecular Weight220.22100
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 52962-26-2 |
| Catalog No. | 2A-9063272 |
| Chinese Name | 3-(2-羧基苯基)戊烷-2,4-二酮 |
| Synonyms | 3-(o-carboxyphenyl)pentane-2,4-dione; 2-<1-Acetyl-2-oxo-propyl>-benzoesaeure; 2-Diacetylmethyl-benzoesaeure; 3-(2-Carboxy-phenyl)-pentandion-(2.4); 3-(2-Carboxyphenyl)pentane-2,4-dione; 2-(1-acetyl-2-oxo-propyl)-benzoic acid; ms-(2-Carboxy-phenyl)-acetylaceton |
| Molecular Formula | C12H12O4 |
| Molecular Weight | 220.22100 |
| HTC | 2918300090 |
| SMILES | CC(=O)C(C(C)=O)c1ccccc1C(=O)O |
| InChI Key | CKPUMDIQROCRDB-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Benzeneacetic acid, 3-ethoxy-4-hydroxy- | 80018-50-4 | 2A-9063257 |
| Benzeneacetic acid, 3,5-dimethoxy- | 4670-10-4 | 2A-9063258 |
| Benzeneacetic acid, 2,4,6-trimethoxy- | 104397-80-0 | 2A-9063262 |
| Benzeneacetic acid, 2,3,4-trimethoxy- | 22480-91-7 | 2A-9063266 |
| Butanoic acid, 3-oxo-,2-cyanoethyl ester | 65193-87-5 | 2A-9063271 |
| Urea, N,N'-bis[3-(dimethylamino)propyl]- | 52338-87-1 | 2A-9063276 |
| Methyl 2-hydroxy-1-naphthoate | 947-65-9 | 2A-9063279 |
| 4-(2-N,N-Dimethylaminoethoxyl)-1-nitrobenzene | 51344-13-9 | 2A-9063286 |
| 4-[2-(Dimethylamino)ethoxy]aniline | 62345-76-0 | 2A-9063287 |
| Methyl 2-(4-methylpiperazin-1-yl)acetate | 5780-70-1 | 2A-9063288 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA