
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 104397-80-0 |
| Catalog No. | 2A-9063262 |
| Chinese Name | 2,4,6-三甲氧基苯乙酸 |
| Synonyms | 2-(2,4,6-trimethoxyphenyl)-acetic acid; (2,4,6-trimethoxy-phenyl)-acetic acid; (2,4,6-Trimethoxy-phenyl)-essigsaeure |
| Molecular Formula | C11H14O5 |
| Molecular Weight | 226.22600 |
| Density | 1.197 g/cm3 |
| Boiling Point | 376.3ºC at 760 mmHg |
| Melting Point | 182-185ºC |
| Storage Condition | room temperature |
| HTC | 2918990090 |
| SMILES | COc1cc(OC)c(CC(=O)O)c(OC)c1 |
| InChI Key | XVJDJIVBWDQELV-UHFFFAOYSA-N |
| MSDS | msds/63262_2_104397_80_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Benzenepropanoic acid, 2,4,6-trimethoxy-.alpha.-oxo- | 105338-31-6 | 2A-9063246 |
| Benzenepropanoic acid, 2,5-dimethoxy-.alpha.-oxo- | 116632-49-6 | 2A-9063247 |
| Benzenepropanoic acid, 3-ethoxy-4-hydroxy-.alpha.-oxo- | 953750-12-4 | 2A-9063249 |
| Benzeneacetic acid, 3-ethoxy-4-hydroxy- | 80018-50-4 | 2A-9063257 |
| Benzeneacetic acid, 3,5-dimethoxy- | 4670-10-4 | 2A-9063258 |
| Benzeneacetic acid, 2,3,4-trimethoxy- | 22480-91-7 | 2A-9063266 |
| Butanoic acid, 3-oxo-,2-cyanoethyl ester | 65193-87-5 | 2A-9063271 |
| Benzoic acid, 2-(1-acetyl-2-oxopropyl)- | 52962-26-2 | 2A-9063272 |
| Urea, N,N'-bis[3-(dimethylamino)propyl]- | 52338-87-1 | 2A-9063276 |
| Methyl 2-hydroxy-1-naphthoate | 947-65-9 | 2A-9063279 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA