
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 72835-87-1 |
| Catalog No. | 2A-9062934 |
| Chinese Name | 3-(2,6-二氯苯基)-3-氧代丙酸乙酯 |
| Synonyms | 2,6-Dichloro-beta-Oxo-Benzenepropanoic Acid Ethyl Ester; AC-7796; ethyl 2,6-dichlorobenzoylacetate |
| Molecular Formula | C11H10O3Cl2 |
| Molecular Weight | 261.1 |
| Density | 1.319 g/cm3 |
| Boiling Point | 290.6ºC at 760 mmHg |
| Storage Condition | 2-8℃, dry |
| HTC | 2918300090 |
| MDL Number | MFCD08458321 |
| SMILES | CCOC(=O)CC(=O)c1c(Cl)cccc1Cl |
| InChI Key | GJUHMKHPXHMWQI-UHFFFAOYSA-N |
| MSDS | msds/62934_1_72835_87_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Benzenepropanoic acid, 2-bromo-.beta.-oxo-, ethyl ester | 50671-05-1 | 2A-9062920 |
| Benzenepropanoic acid, 2-fluoro-.beta.-oxo-, ethyl ester | 1479-24-9 | 2A-9062921 |
| Acetic acid, 2-[(9-oxo-9H-thioxanthen-2-yl)oxy]- | 84434-05-9 | 2A-9062924 |
| Benzenepropanoic acid, 2,4,6-trimethyl-.beta.-oxo-, ethyl ester | 54458-28-5 | 2A-9062926 |
| Benzenepropanoic acid, 2,6-dimethyl-.beta.-oxo-, ethyl ester | 1034771-57-7 | 2A-9062930 |
| 7-Aminoquinazolin-4-ol | 90004-09-4 | 2A-9062937 |
| 7-Bromoquinazolin-4(3H)-one | 194851-16-6 | 2A-9062941 |
| 1-(4-Chlorophenyl)-2-methyl-2-propanamine hydrochloride | 461-78-9 | 2A-9062944 |
| 4-Chloro-2-methylpyrimidin-5-amine | 20090-59-9 | 2A-9062946 |
| Acetic acid, 2-[2-[(4-methylphenyl)sulfonyl]hydrazinylidene]- | 14661-68-8 | 2A-9062952 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA