
CAS Number54458-28-5
Synonyms3-Oxo-3-(2.4.6-trimethyl-phenyl)-propionsaeure-aethylester; 3-mesityl-3-oxo-propionic acid ethyl ester; 3-Mesityl-3-oxo-propionsaeure-aethylester; 2-Mesitoyl-essigsaeureethylester
Molecular FormulaC14H18O3
Molecular Weight415.52
Purity≥98 (HPLC)%
Density1.051g/cm3
Boiling Point326.5ºC at 760 mmHg
Appearancepowder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 54458-28-5 |
| Catalog No. | 2A-9062926 |
| Chinese Name | 3-氧代-3-(2,4,6-三甲基苯基)丙酸乙酯 |
| Synonyms | 3-Oxo-3-(2.4.6-trimethyl-phenyl)-propionsaeure-aethylester; 3-mesityl-3-oxo-propionic acid ethyl ester; 3-Mesityl-3-oxo-propionsaeure-aethylester; 2-Mesitoyl-essigsaeureethylester |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 415.52 |
| Purity | ≥98 (HPLC) |
| Density | 1.051g/cm3 |
| Boiling Point | 326.5ºC at 760 mmHg |
| Appearance | powder |
| HTC | 2918300090 |
| MDL Number | MFCD28133391 |
| SMILES | O=C(CC(C)(C)C1)C2=C1NC(C)=C(C(OCC)=O)C2C(C=C3)=CC=C3C4=CC=CC=C4 |
| InChI | 1S/C27H29NO3/c1-5-31-26(30)23-17(2)28-21-15-27(3,4)16-22(29)25(21)24(23)20-13-11-19(12-14-20)18-9-7-6-8-10-18/h6-14,24,28H,5,15-16H2,1-4H3 |
| InChI Key | ULFUJLFTRWWLPO-UHFFFAOYSA-N |
| NACRES Code | NA.77 |
| UNSPSC | 12352200 |
| MSDS | msds/62926_1_54458_28_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Benzenepropanoic acid, 2-methoxy-.beta.-oxo-, ethyl ester | 41607-95-8 | 2A-9062915 |
| Benzenepropanoic acid, 2-chloro-.beta.-oxo-, ethyl ester | 19112-35-7 | 2A-9062919 |
| Benzenepropanoic acid, 2-bromo-.beta.-oxo-, ethyl ester | 50671-05-1 | 2A-9062920 |
| Benzenepropanoic acid, 2-fluoro-.beta.-oxo-, ethyl ester | 1479-24-9 | 2A-9062921 |
| Acetic acid, 2-[(9-oxo-9H-thioxanthen-2-yl)oxy]- | 84434-05-9 | 2A-9062924 |
| Benzenepropanoic acid, 2,6-dimethyl-.beta.-oxo-, ethyl ester | 1034771-57-7 | 2A-9062930 |
| Benzenepropanoic acid, 2,6-dichloro-.beta.-oxo-, ethyl ester | 72835-87-1 | 2A-9062934 |
| 7-Aminoquinazolin-4-ol | 90004-09-4 | 2A-9062937 |
| 7-Bromoquinazolin-4(3H)-one | 194851-16-6 | 2A-9062941 |
| 1-(4-Chlorophenyl)-2-methyl-2-propanamine hydrochloride | 461-78-9 | 2A-9062944 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA