
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 7472-69-7 |
| Catalog No. | 2A-9062587 |
| Chinese Name | 2-(4-溴苯氧基)-2-甲基丙酸 |
| Synonyms | 2-(4-Bromophenoxy)-2-methylpropanoic acid |
| Molecular Formula | C10H11O3Br1 |
| Molecular Weight | 259.1 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 344.5±17.0 °C at 760 mmHg |
| HTC | 2918990090 |
| MDL Number | MFCD01995843 |
| SMILES | CC(C)(Oc1ccc(Br)cc1)C(=O)O |
| InChI | InChI=1S/C10H11BrO3/c1-10(2,9(12)13)14-8-5-3-7(11)4-6-8/h3-6H,1-2H3,(H,12,13) |
| InChI Key | NRDUHXQTTOHIJX-UHFFFAOYSA-N |
| MSDS | msds/62587_1_7472_69_7.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Propanoic acid, 2-methyl-2-(4-methylphenoxy)- | 23438-11-1 | 2A-9062581 |
| Propanoic acid, 2-methyl-2-(3-methylphenoxy)- | 53498-64-9 | 2A-9062582 |
| Propanoic acid, 2-methyl-2-(2-methylphenoxy)- | 53498-62-7 | 2A-9062583 |
| Propanoic acid, 2-(2,6-dimethylphenoxy)-2-methyl- | 938130-37-1 | 2A-9062584 |
| Propanoic acid, 2-methyl-2-(2,4,6-trimethylphenoxy)- | 75066-21-6 | 2A-9062585 |
| Propanoic acid, 2-(4-fluorophenoxy)-2-methyl- | 587-11-1 | 2A-9062588 |
| Propanoic acid, 2-(4-methoxyphenoxy)-2-methyl- | 17509-54-5 | 2A-9062589 |
| Propanoic acid, 2-methyl-2-(2,4,6-trichlorophenoxy)- | 53625-00-6 | 2A-9062591 |
| Pentamycin | 2A-153748 | 2A-9062592 |
| Propanoic acid, 2-(2,6-dichlorophenoxy)-2-methyl- | 16740-71-9 | 2A-9062593 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA