
CAS Number23438-11-1
Synonyms2-methyl-2-(4-methylphenoxy)propanoic acid; 2-methyl-2-(4-methylphenoxy)propionic acid; 2-Methyl-2-p-tolyloxy-propionic acid; BAS 13531847; ST5321722
Molecular FormulaC11H14O3
Molecular Weight194.23
Density1.116g/cm3
Boiling Point310ºC at 760 mmHg
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 23438-11-1 |
| Catalog No. | 2A-9062581 |
| Chinese Name | 2-甲基-2-(4-甲基苯氧基)丙酸 |
| Synonyms | 2-methyl-2-(4-methylphenoxy)propanoic acid; 2-methyl-2-(4-methylphenoxy)propionic acid; 2-Methyl-2-p-tolyloxy-propionic acid; BAS 13531847; ST5321722 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 |
| Density | 1.116g/cm3 |
| Boiling Point | 310ºC at 760 mmHg |
| Appearance | solid |
| HTC | 2918990090 |
| PubChem ID | 329782070 |
| MDL Number | MFCD01695484 |
| SMILES | Cc1ccc(OC(C)(C)C(O)=O)cc1 |
| InChI | 1S/C11H14O3/c1-8-4-6-9(7-5-8)14-11(2,3)10(12)13/h4-7H,1-3H3,(H,12,13) |
| InChI Key | OQUCRQLGCRZSBH-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352106 |
| MSDS | msds/62581_1_23438_11_1.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Benzeneacetic acid, .alpha.-formyl-4-methoxy-, methyl ester | 63857-14-7 | 2A-9062574 |
| 2-Propanone, 1-nitro- | 10230-68-9 | 2A-9062575 |
| Acetamide, N-[4-(3-bromo-1-oxopropyl)phenyl]- | 99859-23-1 | 2A-9062577 |
| Propanoic acid, 2-(2-chlorophenoxy)-2-methyl- | 17413-79-5 | 2A-9062579 |
| Propanoic acid, 2-(3-chlorophenoxy)-2-methyl- | 17413-73-9 | 2A-9062580 |
| Propanoic acid, 2-methyl-2-(3-methylphenoxy)- | 53498-64-9 | 2A-9062582 |
| Propanoic acid, 2-methyl-2-(2-methylphenoxy)- | 53498-62-7 | 2A-9062583 |
| Propanoic acid, 2-(2,6-dimethylphenoxy)-2-methyl- | 938130-37-1 | 2A-9062584 |
| Propanoic acid, 2-methyl-2-(2,4,6-trimethylphenoxy)- | 75066-21-6 | 2A-9062585 |
| Propanoic acid, 2-(4-bromophenoxy)-2-methyl- | 7472-69-7 | 2A-9062587 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA