
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 6281-32-9 |
| Catalog No. | 2A-9062037 |
| Chinese Name | 4-喹啉甲醇 |
| Synonyms | 4-Hydroxymethylquinoline; EINECS 228-489-8; quinolin-4-yl-methanol; 4-Quinolylmethanol; 4-quinoline methanol; 4-quinolylmethan-1-ol |
| Molecular Formula | C10H9O1N1 |
| Molecular Weight | 159.19 |
| Density | 1.218g/cm3 |
| Boiling Point | 340.5ºC at 760 mmHg |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2933499090 |
| MDL Number | MFCD01006059 |
| SMILES | OCc1ccnc2ccccc12 |
| InChI | InChI=1S/C10H9NO/c12-7-8-5-6-11-10-4-2-1-3-9(8)10/h1-6,12H,7H2 |
| InChI Key | KXYNLLGPBDUAHW-UHFFFAOYSA-N |
| MSDS | msds/62037_1_6281_32_9.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| Ethanone, 1-(5-methoxy-2-benzofuranyl)- | 21587-39-3 | 2A-9062016 |
| Benzothiazole, 2,6-dimethyl- | 2941-71-1 | 2A-9062027 |
| Benzothiazole, 6-chloro-2-methyl- | 4146-24-1 | 2A-9062029 |
| Benzothiazole, 6-fluoro-2-methyl- | 399-73-5 | 2A-9062033 |
| Benzothiazole, 6-methoxy-2-methyl- | 2941-72-2 | 2A-9062036 |
| Benzothiazole, 6-ethoxy-2-methyl- | 18879-72-6 | 2A-9062038 |
| Benzothiazole, 2-methyl-6-(trifluoromethoxy)- | 399-20-2 | 2A-9062040 |
| Benzothiazole, 2-methyl-6-(trifluoromethyl)- | 16368-49-3 | 2A-9062043 |
| Benzothiazole, 6-ethyl-2-methyl- | 18879-32-8 | 2A-9062045 |
| 2-(4-Amino-2-hydroxyphenyl)isoindoline-1,3-dione | 117346-08-4 | 2A-9062046 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA