
CAS Number2941-71-1
Synonyms2,5-DIMETHYL-1,2-DIHYDRO-PYRAZOL-3-ONE; 2,6-Dimethyl-benzothiazol; 2,6-dimethylbenzothiazole; 2,6-Dimethyl-benzthiazol; 2,6-Dimethyl-benzo<1,3>thiazol; 2,6-dimethyl-benzothiazole; Benzothiazole,2,6-dimethyl; 2,6-Dimethylbenzo[d]thiazole
Molecular FormulaC16H16N2OS
Molecular Weight284.383
Density1.176g/cm3
Boiling Point259.4ºC at 760 mmHg
AppearanceLiquid;Colorless to Almost colorless clear liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2941-71-1 |
| Catalog No. | 2A-9062027 |
| Chinese Name | 2,6-二甲基苯并噻唑 |
| Synonyms | 2,5-DIMETHYL-1,2-DIHYDRO-PYRAZOL-3-ONE; 2,6-Dimethyl-benzothiazol; 2,6-dimethylbenzothiazole; 2,6-Dimethyl-benzthiazol; 2,6-Dimethyl-benzo<1,3>thiazol; 2,6-dimethyl-benzothiazole; Benzothiazole,2,6-dimethyl; 2,6-Dimethylbenzo[d]thiazole |
| Molecular Formula | C16H16N2OS |
| Molecular Weight | 284.383 |
| Density | 1.176g/cm3 |
| Boiling Point | 259.4ºC at 760 mmHg |
| Appearance | Liquid;Colorless to Almost colorless clear liquid |
| HTC | 2934999090 |
| MDL Number | MFCD02666764 |
| SMILES | Cc1ccc2nc(C)sc2c1 |
| InChI | InChI=1S/C9H9NS/c1-6-3-4-8-9(5-6)11-7(2)10-8/h3-5H,1-2H3 |
| InChI Key | JEKCSLMWKCKDCC-UHFFFAOYSA-N |
| MSDS | msds/62027_1_2941_71_1.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified 2,6-Dimethylbenzothiazole Modification number: 5 |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 1-Propanone, 1-(2-benzofuranyl)-2-methyl- | 91420-41-6 | 2A-9061989 |
| Ethanone, 1-(5-chloro-2-benzofuranyl)- | 1646-32-8 | 2A-9061995 |
| 4-Chloro-2-methylpyrimidine | 4994-86-9 | 2A-9061998 |
| Ethanone, 1-(5-bromo-2-benzofuranyl)- | 38220-75-6 | 2A-9062003 |
| Ethanone, 1-(5-methoxy-2-benzofuranyl)- | 21587-39-3 | 2A-9062016 |
| Benzothiazole, 6-chloro-2-methyl- | 4146-24-1 | 2A-9062029 |
| Benzothiazole, 6-fluoro-2-methyl- | 399-73-5 | 2A-9062033 |
| Benzothiazole, 6-methoxy-2-methyl- | 2941-72-2 | 2A-9062036 |
| 4-Quinolylmethanol | 6281-32-9 | 2A-9062037 |
| Benzothiazole, 6-ethoxy-2-methyl- | 18879-72-6 | 2A-9062038 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA