
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 90940-40-2 |
| Catalog No. | 2A-9061138 |
| Chinese Name | 2-(4-氯-苯基)-环丙烷羧酸 |
| Synonyms | MFCD03419437 |
| Molecular Formula | C10H9O2Cl1 |
| Molecular Weight | 196.63 |
| Purity | 97 |
| Density | 1.388g/cm3 |
| Boiling Point | 346.9ºC at 760 mmHg |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2916399090 |
| MDL Number | MFCD03419437 |
| SMILES | O=C(O)C1CC1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H9ClO2/c11-7-3-1-6(2-4-7)8-5-9(8)10(12)13/h1-4,8-9H,5H2,(H,12,13) |
| InChI Key | JZYXJKBNUJJIKU-UHFFFAOYSA-N |
| MSDS | msds/61138_1_90940_40_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| Formaldehyde diisopropyl acetal | 2568-89-0 | 2A-9060867 |
| DIPHENYLACETALDEHYDE | 947-91-1 | 2A-9060993 |
| Cyclopentanecarboxylic acid, 3-hydroxy-, methyl ester, (1R-cis)- (9CI) | 174292-59-2 | 2A-9061065 |
| RU 58841; 4-(4,4-Dimethyl-2,5-dioxo-3-(4-hydroxybutyl)1-imidazolidinyl)-2-(trifluoromethyl)benzonitrile | 154992-24-2 | 2A-9061086 |
| 3-PICOLINE-4-BORONIC ACID HCL | 1072952-40-9 | 2A-9061096 |
| 2-Chloro-5-(trifluoromethyl)isonicotinic acid | 505084-58-2 | 2A-9061139 |
| CHLOROMETHYL BENZOATE | 5335-05-7 | 2A-9061161 |
| 7-Amino-3-vinyl-3-cephem-4-carboxylic acid; 7-AVCA | 79349-82-9 | 2A-9061182 |
| 2-Oxa-5-aza-spiro[3,4]octane | 90207-55-9 | 2A-9061202 |
| 2-oxa-5-azaspiro[3,4]octane-5-carboxylic acid tert-butyl ester | 1245816-30-1 | 2A-9061203 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA