
CAS Number40782-53-4
Synonyms4-(n-octyloxy)benzoyl chloride; p-octyloxy benzoic acid chloride; 4-(n-octyloxy)bezoyl chloride; MFCD00799348; 4-n-octyloxybenzoic acid chloride; 4-n-octyloxybenzoic chloride; 4-octyloxy benzoyl chloride; p-1S-methylheptyloxy benzoylchloride
Molecular FormulaC15H21ClO2
Molecular Weight268.77900
Purity98%
Density1.252 g/mL at 25 °C(lit.)
Boiling Point129 °C(lit.)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 40782-53-4 |
| Catalog No. | 2A-9006067 |
| Chinese Name | 4-辛氧基苯甲酰氯 |
| Synonyms | 4-(n-octyloxy)benzoyl chloride; p-octyloxy benzoic acid chloride; 4-(n-octyloxy)bezoyl chloride; MFCD00799348; 4-n-octyloxybenzoic acid chloride; 4-n-octyloxybenzoic chloride; 4-octyloxy benzoyl chloride; p-1S-methylheptyloxy benzoylchloride |
| Molecular Formula | C15H21ClO2 |
| Molecular Weight | 268.77900 |
| Purity | 98 |
| Density | 1.252 g/mL at 25 °C(lit.) |
| Boiling Point | 129 °C(lit.) |
| HTC | 2918990090 |
| SMILES | CCCCCCCCOc1ccc(C(=O)Cl)cc1 |
| InChI Key | YXBOJGHBKKAPOG-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-n-Propoxybenzoic acid | 5438-19-7 | 2A-9006060 |
| 4-n-Propoxyphenol | 18979-50-5 | 2A-9006061 |
| 4-n-Propylbenzoic acid | 2438-05-3 | 2A-9006062 |
| 4-n-Propylbiphenyl | 71294-42-3 | 2A-9006063 |
| 4-n-Propylphenol | 645-56-7 | 2A-9006064 |
| 4-Oxalic acid (N-methyl)amide | 615-35-0 | 2A-9006068 |
| 4-Oxo-2,2,6,6-tetramethylpiperidinooxy | 2896-70-0 | 2A-9006071 |
| 4-Oxo-4-(2-pyridyl)butyric acid | 5768-27-4 | 2A-9006073 |
| 4-Oxo-4-(4-tolyl)butyric acid | 4619-20-9 | 2A-9006074 |
| 4-Oxo-4-piperazin-1-yl-butyric acid | 72547-43-4 | 2A-9006076 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA