
CAS Number2438-05-3
Synonyms4-n-propylbenzoic acid; 4-Propyl-benzoesaeure; 4-Propyl-benzoic acid; MFCD00013996; p-Propyl benzoic acid; 4-Propylbenzoic acid; 4-Propylbenzolic acid; p-n-Propyl benzoic acid
Molecular FormulaC10H12O2
Molecular Weight215.03
Purity≥95%
Density1.1±0.1 g/cm3
Boiling Point285.1±19.0 °C at 760 mmHg
Melting Point142-144 °C(lit.)
Appearancesolid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2438-05-3 |
| Catalog No. | 2A-9006062 |
| Chinese Name | 4-丙基苯甲酸 |
| Synonyms | 4-n-propylbenzoic acid; 4-Propyl-benzoesaeure; 4-Propyl-benzoic acid; MFCD00013996; p-Propyl benzoic acid; 4-Propylbenzoic acid; 4-Propylbenzolic acid; p-n-Propyl benzoic acid |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 215.03 |
| Purity | ≥95 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 285.1±19.0 °C at 760 mmHg |
| Melting Point | 142-144 °C(lit.) |
| Appearance | solid |
| Storage Condition | Keep container tightly closed and stored in a cool |
| HTC | 2916.39.4500 |
| PubChem ID | 329763558 |
| MDL Number | MFCD02179473 |
| SMILES | CS(=O)(=O)Nc1ccc(cc1)B(O)O |
| InChI | 1S/C7H10BNO4S/c1-14(12,13)9-7-4-2-6(3-5-7)8(10)11/h2-5,9-11H,1H3 |
| InChI Key | NDVJJEADFLTFCD-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352103 |
| Hazard Symbols | Xn |
| Risk Codes | R22;R36/37/38 |
| Safety Description | S26;S37/39 |
| MSDS | msds/6062_1_2438_05_3.pdf |
| Transport Info | Product name: Purity: 99.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified 4-propylbenzoic acid |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-n-Pentylcyclohexanone | 61203-83-6 | 2A-9006057 |
| 4-n-Pentyloxybenzoic acid | 15872-41-0 | 2A-9006058 |
| 4-n-Pentylphenol | 14938-35-3 | 2A-9006059 |
| 4-n-Propoxybenzoic acid | 5438-19-7 | 2A-9006060 |
| 4-n-Propoxyphenol | 18979-50-5 | 2A-9006061 |
| 4-n-Propylbiphenyl | 71294-42-3 | 2A-9006063 |
| 4-n-Propylphenol | 645-56-7 | 2A-9006064 |
| 4-Octyloxybenzoyl chloride | 40782-53-4 | 2A-9006067 |
| 4-Oxalic acid (N-methyl)amide | 615-35-0 | 2A-9006068 |
| 4-Oxo-2,2,6,6-tetramethylpiperidinooxy | 2896-70-0 | 2A-9006071 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA