
CAS Number53298-30-9
Synonyms2-methylsulfonylethyl p-nitrophenyl carbonate; 2-(methylsulphonyl)-ethyl-4-nitrophenylcarbonate; 2-(Methylsulfonyl)ethyl 4-nitrophenyl carbonate; 2-(Methylsulfonyl)-aethyl-p-nitrophenyl-carbonat; Carbonic acid, 2-(methylsulfonyl)ethyl 4-nitrophenyl ester; 4-nitrophenyl 2-(methylsulfonyl)ethyl carbonate; 2-(methylsulfonyl)ethyl-4-nitrophenylcarbonat; 2-(METHYLSULFONYL)ETHYL4-NITROPHENYLCARBONATE
Molecular FormulaC10H11NO7S
Molecular Weight283.35
Purity≥97.0%
Density1.5±0.1 g/cm3
Boiling Point527.0±50.0 °C at 760 mmHg
Melting Point35-40 °C
Appearancecrystals
EINECS279-406-7
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 53298-30-9 |
| Catalog No. | 2A-9060301 |
| Chinese Name | 碳酸2-(甲基磺酰基)乙酯4-硝基苯酯 |
| Synonyms | 2-methylsulfonylethyl p-nitrophenyl carbonate; 2-(methylsulphonyl)-ethyl-4-nitrophenylcarbonate; 2-(Methylsulfonyl)ethyl 4-nitrophenyl carbonate; 2-(Methylsulfonyl)-aethyl-p-nitrophenyl-carbonat; Carbonic acid, 2-(methylsulfonyl)ethyl 4-nitrophenyl ester; 4-nitrophenyl 2-(methylsulfonyl)ethyl carbonate; 2-(methylsulfonyl)ethyl-4-nitrophenylcarbonat; 2-(METHYLSULFONYL)ETHYL4-NITROPHENYLCARBONATE |
| Molecular Formula | C10H11NO7S |
| Molecular Weight | 283.35 |
| Purity | ≥97.0 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 527.0±50.0 °C at 760 mmHg |
| Melting Point | 35-40 °C |
| Appearance | crystals |
| EINECS | 279-406-7 |
| HTC | 2920909090 |
| PubChem ID | 57653487 |
| MDL Number | MFCD00042930 |
| SMILES | C[Si](C)(C)CCOC(=O)Oc1ccc(cc1)[N+]([O-])=O |
| InChI | 1S/C12H17NO5Si/c1-19(2,3)9-8-17-12(14)18-11-6-4-10(5-7-11)13(15)16/h4-7H,8-9H2,1-3H3 |
| InChI Key | ZAQWGGKIMQIVGM-UHFFFAOYSA-N |
| Beilstein/REAXYS | 4320585 |
| NACRES Code | NA.22 |
| UNSPSC | 12352108 |
| MSDS | msds/60301_1_53298_30_9.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 5-BROMO-2,3-DIAMINOFLUOROBENZENE | 517920-69-3 | 2A-9060293 |
| Silodosin | 160970-54-7 | 2A-9060294 |
| Talampanel | 161832-65-1 | 2A-9060295 |
| Rauwolfia | 8063-17-0 | 2A-9060296 |
| ANSAMITOCIN P-3 | 66547-09-9 | 2A-9060300 |
| CERIUM(III) NITRATE HEXAHYDRATE | 17309-53-4 | 2A-9060302 |
| 3-(2-Bromo-acetyl)-benzoic acid methyl ester | 27475-19-0 | 2A-9060304 |
| LITHIUM HEXAFLUOROARSENATE(V) | 29935-35-1 | 2A-9060306 |
| Romidepsin | 128517-07-7 | 2A-9060310 |
| PIPERONYL METHYL KETONE | 4676-39-5 | 2A-9060313 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA