
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 202189-78-4 |
| Catalog No. | 2A-9060164 |
| Chinese Name | 比拉斯汀 |
| Synonyms | Ilaxten; Bilaxten; Bilastine (INN); bilastine; Bilatex; Bilasten |
| Molecular Formula | C28H37N3O3 |
| Molecular Weight | 463.61 |
| Purity | ≥98 (HPLC) |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 639.1±55.0 °C at 760 mmHg |
| Melting Point | 202 °C |
| Appearance | powder |
| Water Solubility | Water solubility: insoluble; very slightly soluble |
| Storage Condition | room temperature |
| Application | Bilastine is a histamine H1 receptor antagonist that can act on allergic rhinoconjunctivitis and urticaria. |
| MDL Number | MFCD09837814 |
| SMILES | [N+H]2(CCC(CC2)c3[n](c4c(n3)cccc4)CCOCC)CCc1ccc(cc1)C(C)(C)C(=O)[O-] |
| InChI | 1S/C28H37N3O3/c1-4-34-20-19-31-25-8-6-5-7-24(25)29-26(31)22-14-17-30(18-15-22)16-13-21-9-11-23(12-10-21)28(2,3)27(32)33/h5-12,22H,4,13-20H2,1-3H3,(H,32,33) |
| InChI Key | ACCMWZWAEFYUGZ-UHFFFAOYSA-N |
| NACRES Code | NA.77 |
| UNSPSC | 12352200 |
| MSDS | msds/60164_1_202189_78_4.pdf |
| Transport Info | Product Name: Bilastin |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| BIMATOPROST | 155206-00-1 | 2A-9060157 |
| ANTIMONY DICHLOROTRIFLUORIDE | 7791-16-4 | 2A-9060158 |
| ETHYL 2-CYANOACRYLATE | 7085-85-0 | 2A-9060159 |
| trifluoroethane | 27987-06-0 | 2A-9060160 |
| ETHYL 4-HYDROXYMANDELATE | 68758-68-9 | 2A-9060162 |
| DYNEMICIN A | 124412-57-3 | 2A-9060165 |
| N-(3-amino-4-ethoxyphenyl)acetamide | 17026-81-2 | 2A-9060166 |
| 8-CHLORO-8-NONENOIC ACID | 73177-33-0 | 2A-9060170 |
| C-(4-FLUORO-PHENYL)-C-(1-METHYL-1H-IMIDAZOL-2-YL)-METHYLAMINE | 872107-78-3 | 2A-9060171 |
| 3-(4-METHOXY-PHENYL)-2-PHENYL-PROPIONIC ACID | 4314-68-5 | 2A-9060175 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA