
CAS Number299-39-8
Synonyms(7α,9α)-Sparteine sulfate (1:1); Sparteinsulfat; (-)-Spartein,Sulfat; spartocin; Sparteine, sulfate; spareng; sparteine mono(hydrogen sulfate); sparteal; (-)-sparteine,sulfate; (1S,2R,9S,10S)-7,15-Diazatetracyclo[7.7.1.0.0]heptadecansulfat; (1S,2R,9S,10S)-7,15-Diazatetracyclo[7.7.1.0.0]heptadecane sulfate; Sparteine sulfate (VAN); [7S; sparm; Sparteine, sulfate (1:1); spartin; spartein sulfate pentahydrate; Sparteine sulfate anhydrous; spatym; Spartea; spartepur; (1S,2R,9S,10S)-7,15-Diazatétracyclo[7.7.1.0.0]heptadécane sulfate; Sparteine Sulfate; spal; L-Spartein sulfat; Sparteine sulfate (1:1)
Molecular FormulaC15H28N2O4S
Molecular Weight332.46
Boiling Point340.9ºC at 760mmHg
Melting Point135ºC
AppearanceColorless crystal or white crystalline powder
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 299-39-8 |
| Catalog No. | 2A-9060087 |
| Chinese Name | 硫酸金雀花碱 |
| Synonyms | (7α,9α)-Sparteine sulfate (1:1); Sparteinsulfat; (-)-Spartein,Sulfat; spartocin; Sparteine, sulfate; spareng; sparteine mono(hydrogen sulfate); sparteal; (-)-sparteine,sulfate; (1S,2R,9S,10S)-7,15-Diazatetracyclo[7.7.1.0.0]heptadecansulfat; (1S,2R,9S,10S)-7,15-Diazatetracyclo[7.7.1.0.0]heptadecane sulfate; Sparteine sulfate (VAN); [7S; sparm; Sparteine, sulfate (1:1); spartin; spartein sulfate pentahydrate; Sparteine sulfate anhydrous; spatym; Spartea; spartepur; (1S,2R,9S,10S)-7,15-Diazatétracyclo[7.7.1.0.0]heptadécane sulfate; Sparteine Sulfate; spal; L-Spartein sulfat; Sparteine sulfate (1:1) |
| Molecular Formula | C15H28N2O4S |
| Molecular Weight | 332.46 |
| Boiling Point | 340.9ºC at 760mmHg |
| Melting Point | 135ºC |
| Appearance | Colorless crystal or white crystalline powder |
| Storage Condition | -20°C |
| Packaging | III |
| Application | (-)-Sparteine (sulfate) is a quinolizidine alkaloid that can be extracted from Lupinus. (-)-Sparteine (sulfate) inhibits the release of acetylcholine and has anticonvulsant effects. |
| SMILES | C1CCN2CC3CC(CN4CCCCC34)C2C1.O=S(=O)(O)O |
| InChI | InChI=1S/C15H26N2.H2O4S/c1-3-7-16-11-13-9-12(14(16)5-1)10-17-8-4-2-6-15(13)17;1-5(2,3)4/h12-15H,1-11H2;(H2,1,2,3,4) |
| InChI Key | FCEHFCFHANDXMB-NMRUWYRNSA-N |
| Hazard Symbols | 6.1(b) |
| Transport Info | Product name: Cytisine sulfate |
| Related Products in Alkaloids | ||
|---|---|---|
| Acetylaconitine | 77181-26-1 | 2A-9048090 |
| 6-(2-Propenyl)dihydrolysergic acid | 81409-74-7 | 2A-9048618 |
| Ethylnorcotinine | 2A-151075 | 2A-9059664 |
| Methcathinone | 5650-44-2 | 2A-9059776 |
| 2-bromolysergic acid diethylamide | 478-84-2 | 2A-9059986 |
| BRUCINE DIHYDRATE | 145428-94-0 | 2A-9060406 |
| CAFFEINE CITRATE | 69-22-7 | 2A-9060513 |
| Galanthamine Hydrobromide | 1953-04-4 | 2A-9060537 |
| 3,4-methylenedioxy-N-methylcathinone | 186028-79-5 | 2A-9060671 |
| (+)-N-METHYLEPHEDRINE | 42151-56-4 | 2A-9060738 |
| Browse all Alkaloids products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA