
CAS Number98-74-8
Synonyms4-Nitrobenzenesulfonic acid chloride; 4-Nitrobenzenesulfon; p-Nitrophenylsulfonyl chloride; 4-Nitrobenzenesulphonylchloride; para-nitrobenzenesulfonyl chloride; MFCD00007445; 4-nitrobenzene-1-sulfonyl chloride; 4-Nitrobenzenesulfonyl chloride; 4-nitro-benzenesulfonyl chloride; EINECS 202-697-9; 4-NITROPHENYLSULFONYL CHLORIDE; 4-nitro-benzenesulfonylchlorid; Nosylchloride; 4-nitrophenylsulphonyl chloride; P-NITROBENZENESULFONYL CHLORIDE; 4-Nitrophenylsulfonylchloride; 5-Nitrobenzenesulfonyl chloride; nosyl chloride; 4-NITROBENZENESULFONYLCHLORIDE
Molecular FormulaO2NC6H4SO2Cl
Molecular Weight221.62
Purity97%
Density1.6±0.1 g/cm3
Boiling Point349.7±25.0 °C at 760 mmHg
Melting Point66-70 °C (lit.)
AppearanceYellow to brown powder
EINECS202-697-9
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 98-74-8 |
| Catalog No. | 2A-9006007 |
| Chinese Name | 4-硝基苯磺酰氯 |
| Synonyms | 4-Nitrobenzenesulfonic acid chloride; 4-Nitrobenzenesulfon; p-Nitrophenylsulfonyl chloride; 4-Nitrobenzenesulphonylchloride; para-nitrobenzenesulfonyl chloride; MFCD00007445; 4-nitrobenzene-1-sulfonyl chloride; 4-Nitrobenzenesulfonyl chloride; 4-nitro-benzenesulfonyl chloride; EINECS 202-697-9; 4-NITROPHENYLSULFONYL CHLORIDE; 4-nitro-benzenesulfonylchlorid; Nosylchloride; 4-nitrophenylsulphonyl chloride; P-NITROBENZENESULFONYL CHLORIDE; 4-Nitrophenylsulfonylchloride; 5-Nitrobenzenesulfonyl chloride; nosyl chloride; 4-NITROBENZENESULFONYLCHLORIDE |
| Molecular Formula | O2NC6H4SO2Cl |
| Molecular Weight | 221.62 |
| Purity | 97 |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 349.7±25.0 °C at 760 mmHg |
| Melting Point | 66-70 °C (lit.) |
| Appearance | Yellow to brown powder |
| Water Solubility | Insoluble |
| Storage Condition | Store in a cool, dry, well-ventilated warehouse. K |
| Packaging | II |
| EINECS | 202-697-9 |
| HTC | 29049085 |
| PubChem ID | 24856461 |
| MDL Number | MFCD00007445 |
| SMILES | [O-][N+](=O)c1ccc(cc1)S(Cl)(=O)=O |
| InChI | 1S/C6H4ClNO4S/c7-13(11,12)6-3-1-5(2-4-6)8(9)10/h1-4H |
| InChI Key | JXRGUPLJCCDGKG-UHFFFAOYSA-N |
| Beilstein/REAXYS | 746543 |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| Hazard Symbols | 8 |
| MSDS | msds/6007_1_98_74_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Chemical name |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-n-Butylbiphenyl | 37909-95-8 | 2A-9005996 |
| 4-n-Hexyloxybenzoic acid | 1142-39-8 | 2A-9005997 |
| 4-Nitro-1-naphthol | 605-62-9 | 2A-9005998 |
| 4-Nitrobenzamide | 619-80-7 | 2A-9006005 |
| 4'-Nitrobenzanilide | 3393-96-2 | 2A-9006006 |
| 4-Nitrobenzo-15-crown-5 | 60835-69-0 | 2A-9006009 |
| 4-Nitrobenzo-18-crown-6 | 53408-96-1 | 2A-9006010 |
| 4-Nitrobenzoate sodium | 2A-106011 | 2A-9006011 |
| 4-Nitrobenzoate sodium | 2A-106012 | 2A-9006012 |
| 4-Nitrobenzonitrile | 619-72-7 | 2A-9006013 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA