
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1590-21-2 |
| Catalog No. | 2A-9005986 |
| Chinese Name | 4-萘-2-基-4-氧代丁酸甲酯 |
| Synonyms | 4-<2-Naphthyl>-4-oxo-butansaeure-methylester; 3-<2-Naphthoyl>-propionsaeure-methylester |
| Molecular Formula | C15H16O2 |
| Molecular Weight | 228.294 |
| Purity | 97 |
| Density | 1.164g/cm3 |
| Boiling Point | 408.3ºC at 760 mmHg |
| HTC | 2918300090 |
| MDL Number | MFCD00228220 |
| SMILES | COC(=O)CCC(=O)c1ccc2ccccc2c1 |
| InChI Key | SUTZIVCVBFCEBY-UHFFFAOYSA-N |
| MSDS | msds/5986_1_1590_21_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Morpholinoaniline | 2524-67-6 | 2A-9005977 |
| 4-Naphthalen-1-yl-4-oxo-butyric acid | 4653-13-8 | 2A-9005980 |
| 4-Naphthalen-1-yl-benzoic acid | 2A-105982 | 2A-9005982 |
| 4-Naphthalen-1-yl-phenylamine hydrochloride | 2A-105984 | 2A-9005984 |
| 4-Naphthalen-1-yl-thiazol-2-yl-amine | 56503-96-9 | 2A-9005985 |
| 4-Naphthalen-2-yl-benzoic acid | 2A-105988 | 2A-9005988 |
| 4-Naphthalen-2-yl-phenylamine | 2A-105989 | 2A-9005989 |
| 4-Naphthalen-2-yl-thiazol-2-yl-amine | 21331-43-1 | 2A-9005990 |
| 4-N-Butylbenzenesulphonamide | 1135-00-8 | 2A-9005994 |
| 4-n-Butylbenzoic acid | 20651-71-2 | 2A-9005995 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA