
CAS Number4653-13-8
Synonyms4-oxo-4-(1-naphthyl)butanoic acid; Gamma-Oxo-1-naphthalenebutanoic Acid; 4-naphthyl-4-oxobutanoic acid; 4-Naphthalen-1-yl-4-oxo-butyric acid; 3-Oxo-3-(naphthyl-(1))-propan-carbonsaeure-(1); 4-(1-Naphthyl)-4-oxobutanoic acid; MFCD00086599; 4-[1]naphthyl-4-oxo-butyric acid; 4-(naphthalen-1-yl)-4-oxobutanoic acid; 4-[1]Naphthyl-4-oxo-buttersaeure
Molecular FormulaC19H20O3
Molecular Weight296.369
Purity98%
Density1.249 g/cm3
Boiling Point459.6ºC at 760 mmHg
Melting Point175℃
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 4653-13-8 |
| Catalog No. | 2A-9005980 |
| Chinese Name | 4-(1-萘)-4-側氧丁酸 |
| Synonyms | 4-oxo-4-(1-naphthyl)butanoic acid; Gamma-Oxo-1-naphthalenebutanoic Acid; 4-naphthyl-4-oxobutanoic acid; 4-Naphthalen-1-yl-4-oxo-butyric acid; 3-Oxo-3-(naphthyl-(1))-propan-carbonsaeure-(1); 4-(1-Naphthyl)-4-oxobutanoic acid; MFCD00086599; 4-[1]naphthyl-4-oxo-butyric acid; 4-(naphthalen-1-yl)-4-oxobutanoic acid; 4-[1]Naphthyl-4-oxo-buttersaeure |
| Molecular Formula | C19H20O3 |
| Molecular Weight | 296.369 |
| Purity | 98 |
| Density | 1.249 g/cm3 |
| Boiling Point | 459.6ºC at 760 mmHg |
| Melting Point | 175℃ |
| Appearance | solid |
| Storage Condition | Room temperature, sealed, dry |
| HTC | 2918300090 |
| MDL Number | MFCD00230993 |
| SMILES | O=C(O)CCC(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C14H12O3/c15-13(8-9-14(16)17)12-7-3-5-10-4-1-2-6-11(10)12/h1-7H,8-9H2,(H,16,17) |
| InChI Key | YNEXYDHOGAIPHO-UHFFFAOYSA-N |
| MSDS | msds/5980_1_4653_13_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Methylphenylacetonitrile | 2947-61-7 | 2A-9005970 |
| 4-Methylphenylpropionic acid | 1505-50-6 | 2A-9005972 |
| 4-Methylsalicyclic acid | 50-85-1 | 2A-9005974 |
| 4-Methylsalicylamide | 49667-22-3 | 2A-9005975 |
| 4-Morpholinoaniline | 2524-67-6 | 2A-9005977 |
| 4-Naphthalen-1-yl-benzoic acid | 2A-105982 | 2A-9005982 |
| 4-Naphthalen-1-yl-phenylamine hydrochloride | 2A-105984 | 2A-9005984 |
| 4-Naphthalen-1-yl-thiazol-2-yl-amine | 56503-96-9 | 2A-9005985 |
| 4-Naphthalen-2-yl-4-oxo-butyric acid methyl ester | 1590-21-2 | 2A-9005986 |
| 4-Naphthalen-2-yl-benzoic acid | 2A-105988 | 2A-9005988 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA