
CAS Number137071-32-0
SynonymsPimecrolimus; Elidel,SDZ-ASM-981; 33-epi-33-chloro-FR 520; SDZ-ASM 981; Elidel; 33-epi-chloro-33-desoxy-ascomycin; Picrolimus; ASM 981
Molecular FormulaC43H68ClNO11
Molecular Weight810.45
Purity≥97 (HPLC)%
Density1.2±0.1 g/cm3
Boiling Point866.1±75.0 °C at 760 mmHg
Appearancepowder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 137071-32-0 |
| Catalog No. | 2A-9059628 |
| Chinese Name | 吡美莫司 |
| Synonyms | Pimecrolimus; Elidel,SDZ-ASM-981; 33-epi-33-chloro-FR 520; SDZ-ASM 981; Elidel; 33-epi-chloro-33-desoxy-ascomycin; Picrolimus; ASM 981 |
| Molecular Formula | C43H68ClNO11 |
| Molecular Weight | 810.45 |
| Purity | ≥97 (HPLC) |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 866.1±75.0 °C at 760 mmHg |
| Appearance | powder |
| Storage Condition | -20°C Freezer |
| Application | Pimecrolimus is an immunophilin ligand that can specifically bind to the cytoplasmic receptor (immunophilin macrophilin-12). |
| PubChem ID | 329825877 |
| MDL Number | MFCD00901792 |
| SMILES | C[C@H]([C@@H](O)CC([C@H](CC)/C=C1C)=O)[C@](/C(C)=C/[C@@]2([H])C[C@@H](OC)[C@@H](Cl)CC2)([H])OC([C@@]3([H])N(C(C([C@@]4(O)[C@H](C)C[C@H](OC)[C@@H]([C@@H](OC)C[C@@H](C)C\1)O4)=O)=O)CCCC3)=O |
| InChI | 1S/C43H68ClNO11/c1-10-30-18-24(2)17-25(3)19-36(53-8)39-37(54-9)21-27(5)43(51,56-39)40(48)41(49)45-16-12-11-13-32(45)42(50)55-38(28(6)33(46)23-34(30)47)26(4)20-29-14-15-31(44)35(22-29)52-7/h18,20,25,27-33,35-39,46,51H,10-17,19,21-23H2,1-9H3/b24-18+,26-20+/t25-,27+,28+,29-,30+,31-,32-,33-,35+,36-,37-,38+,39+,43+/m0/s1 |
| InChI Key | KASDHRXLYQOAKZ-XDSKOBMDSA-N |
| NACRES Code | NA.77 |
| UNSPSC | 12352200 |
| MSDS | msds/59628_1_137071_32_0.pdf |
| Transport Info | Product Name: Pimecrolimus |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| BERAPROST SODIUM | 88475-69-8 | 2A-9059623 |
| CEFCAPENE PIVOXIL HYDROCHLORIDE | 147816-23-7 | 2A-9059624 |
| Isopropyl Amine HCl | 15572-56-2 | 2A-9059625 |
| Antimony trichloride | 10025-91-9 | 2A-9059626 |
| KHELLIN . | 82-02-0 | 2A-9059627 |
| 9-[1,1'-biphenyl]-4-yl-10-bromo-anthracene | 400607-05-8 | 2A-9059632 |
| ZAPIZOLAM | 64098-32-4 | 2A-9059635 |
| Cilobradine hydrochloride | 186097-54-1 | 2A-9059638 |
| Cerium Sulfate | 13590-82-4 | 2A-9059639 |
| Protoveratrine B | 124-97-0 | 2A-9059640 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA