
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 503612-47-3 |
| Catalog No. | 2A-9057511 |
| Chinese Name | 阿哌沙班 |
| Synonyms | Eliquis; Apixaban; BMS 562247-01; UNII-3Z9Y7UWC1J; S1593_Selleck |
| Molecular Formula | C25H25N5O4 |
| Molecular Weight | 459.50 |
| Purity | ≥98 (HPLC) |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 770.5±60.0 °C at 760 mmHg |
| Appearance | powder |
| Storage Condition | room temperature, dry |
| Application | Apixaban is a highly selective, reversible Factor Xa inhibitor with Ki values of 0.08 nM and 0.17 nM for human and rabbit respectively. |
| MDL Number | MFCD11977295 |
| SMILES | N5(CCCCC5=O)c1ccc(cc1)N2CCc3c([n](nc3C(=O)N)c4ccc(cc4)OC)C2=O |
| InChI | 1S/C25H25N5O4/c1-34-19-11-9-18(10-12-19)30-23-20(22(27-30)24(26)32)13-15-29(25(23)33)17-7-5-16(6-8-17)28-14-3-2-4-21(28)31/h5-12H,2-4,13-15H2,1H3,(H2,26,32) |
| InChI Key | QNZCBYKSOIHPEH-UHFFFAOYSA-N |
| NACRES Code | NA.77 |
| UNSPSC | 12352107 |
| MSDS | msds/57511_1_503612_47_3.pdf |
| Transport Info | Product name: Apixaban |
| Related Products in API & Advanced Intermediates | ||
|---|---|---|
| Edoxaban | 480449-70-5 | 2A-9057413 |
| Sitagliptin | 486460-32-6 | 2A-9057431 |
| Doripenem side-chain | 491878-06-9 | 2A-9057435 |
| Doripenem Condensation Compound | 491878-07-0 | 2A-9057436 |
| Rosuvastatin-5S-lactone | 503610-43-3 | 2A-9057510 |
| Raltegravir | 518048-05-0 | 2A-9057542 |
| Telmisartan methyl ester | 528560-93-2 | 2A-9057567 |
| Sunitinib | 557795-19-4 | 2A-9057603 |
| tert-Buthyl Pitavastatin | 586966-54-3 | 2A-9057635 |
| Carvedilol phosphate hemihydrate | 610309-89-2 | 2A-9057706 |
| Browse all API & Advanced Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA