
CAS Number6159-25-7
Synonyms1-(4-nitro-phenyl)-propane-1,2-dione; 4-(2-Oxopropanoyl)nitrobenzene; 1-(4-Nitro-phenyl)-propan-1,2-dion; MFCD01882876; 4-nitrophenylpropan-1,2-dione; 1-(4'-Nitrophenyl)-propandion-(1,2); 1-<(4-nitro)-phenyl>-1,2-propandione
Molecular FormulaC9H7NO4
Molecular Weight193.15600
Purity98%
Density1.319 g/cm3
Boiling Point341.6ºC at 760 mmHg
Melting Point86-88ºC
AppearanceTransparent light yellow oil
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 6159-25-7 |
| Catalog No. | 2A-9000575 |
| Chinese Name | 1-(4-硝基苯基)-1,2-丙二酮 |
| Synonyms | 1-(4-nitro-phenyl)-propane-1,2-dione; 4-(2-Oxopropanoyl)nitrobenzene; 1-(4-Nitro-phenyl)-propan-1,2-dion; MFCD01882876; 4-nitrophenylpropan-1,2-dione; 1-(4'-Nitrophenyl)-propandion-(1,2); 1-<(4-nitro)-phenyl>-1,2-propandione |
| Molecular Formula | C9H7NO4 |
| Molecular Weight | 193.15600 |
| Purity | 98 |
| Density | 1.319 g/cm3 |
| Boiling Point | 341.6ºC at 760 mmHg |
| Melting Point | 86-88ºC |
| Appearance | Transparent light yellow oil |
| HTC | 2914700090 |
| SMILES | CC(=O)C(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C9H7NO4/c1-6(11)9(12)7-2-4-8(5-3-7)10(13)14/h2-5H,1H3 |
| InChI Key | WCQBWJSIZYUMDJ-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-(4-Methoxyphenyl)-2-(benzylamino)propane | 43229-65-8 | 2A-9000563 |
| 1-(4-Methylphenyl)-4,4,4-triflurobutane-1,3-dione | 720-94-5 | 2A-9000566 |
| 1-(4-Nitrophenyl)-2-thiourea | 3696-22-8 | 2A-9000567 |
| 1-(4-Nitrophenyl)-3-phenyl-2-thiourea | 7669-49-0 | 2A-9000568 |
| 1-(4-Nitrophenyl)imidazoline-2-thione | 6857-35-8 | 2A-9000573 |
| 1-(4-Pyridyl)pyridinium chloride hydrochloride | 5421-92-1 | 2A-9000579 |
| 1-(5-Chloronaphthalene-1-sulfonyl)-1H-hexahydro-1,4-diazepine hydrochloride | 105637-50-1 | 2A-9000583 |
| 1-(6-Methoxy-2-naphthalenyl)-1-heptanone | 53526-25-3 | 2A-9000584 |
| 1-(6-Methoxy-7-methyl-6H-[1,2,5]oxadiazolo[3,4-e]indol-8-yl)ethanone | 306935-64-8 | 2A-9000585 |
| 1-(Aminoformylmethyl)pyridinium chloride | 41220-29-5 | 2A-9000586 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA