
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 43229-65-8 |
| Catalog No. | 2A-9000563 |
| Chinese Name | 1-(4-甲氧苯基)-2-苄胺基丙烷 |
| Synonyms | MFCD00025847; N-benzyl-1-(4-methoxyphenyl)propan-2-amine; EINECS 256-155-1 |
| Molecular Formula | C17H21NO |
| Molecular Weight | 255.363 |
| Purity | 98 |
| Density | 1.024 g/cm3 |
| Boiling Point | 377.8ºC at 760 mmHg |
| Appearance | brown solid |
| Storage Condition | 2-8°C |
| EINECS | 256-155-1 |
| HTC | 2922299090 |
| MDL Number | MFCD00025847 |
| SMILES | COc1ccc(CC(C)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C17H21NO/c1-14(18-13-16-6-4-3-5-7-16)12-15-8-10-17(19-2)11-9-15/h3-11,14,18H,12-13H2,1-2H3 |
| InChI Key | CVGPWMGXKOKNFD-UHFFFAOYSA-N |
| MSDS | msds/563_1_43229_65_8.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-(4-Chlorophenyl)biguanide hydrochloride | 4022-81-5 | 2A-9000541 |
| 1-(4-Chlorophenyl)cyclobutanecarbonitrile | 28049-61-8 | 2A-9000542 |
| 1-(4-Hydroxy-2-chlorophenyl)ethanone | 68301-59-7 | 2A-9000555 |
| 1-(4-Hydroxyphenyl)-2-thiourea | 1520-27-0 | 2A-9000558 |
| 1-(4-Isobutylphenyl)ethanone | 38861-78-8 | 2A-9000562 |
| 1-(4-Methylphenyl)-4,4,4-triflurobutane-1,3-dione | 720-94-5 | 2A-9000566 |
| 1-(4-Nitrophenyl)-2-thiourea | 3696-22-8 | 2A-9000567 |
| 1-(4-Nitrophenyl)-3-phenyl-2-thiourea | 7669-49-0 | 2A-9000568 |
| 1-(4-Nitrophenyl)imidazoline-2-thione | 6857-35-8 | 2A-9000573 |
| 1-(4-Nitrophenyl)propane-1,2-dione | 6159-25-7 | 2A-9000575 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA