
CAS Number1205-06-7
Synonyms4-Isothiocyanato-Benzoic Acid Ethyl Ester; 4-ETHOXYCARBONYLPHENYL-ISOTHIOCYANATE; ethyl p-isothiocyanatobenzoate; p-ethoxycarbonylphenyl isothiocyanate; 4-carbethoxyphenyl isothiocyanate; 4-carboethoxy-phenylisothiocyanate; EINECS 214-880-0; MFCD00022058; 4-Isothiocyanatobenzoesaeure-ethylester; Benzoic acid,4-isothiocyanato-,ethyl ester
Molecular FormulaC10H9O2N1S1
Molecular Weight207.25
Purity97%
Density1.14 g/cm3
Boiling Point123-127°C 1mm
Melting Point57 °C
AppearanceWhite to yellow solid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1205-06-7 |
| Catalog No. | 2A-9005716 |
| Chinese Name | 4-乙氧羰基苯基硫代异氰酸酯 |
| Synonyms | 4-Isothiocyanato-Benzoic Acid Ethyl Ester; 4-ETHOXYCARBONYLPHENYL-ISOTHIOCYANATE; ethyl p-isothiocyanatobenzoate; p-ethoxycarbonylphenyl isothiocyanate; 4-carbethoxyphenyl isothiocyanate; 4-carboethoxy-phenylisothiocyanate; EINECS 214-880-0; MFCD00022058; 4-Isothiocyanatobenzoesaeure-ethylester; Benzoic acid,4-isothiocyanato-,ethyl ester |
| Molecular Formula | C10H9O2N1S1 |
| Molecular Weight | 207.25 |
| Purity | 97 |
| Density | 1.14 g/cm3 |
| Boiling Point | 123-127°C 1mm |
| Melting Point | 57 °C |
| Appearance | White to yellow solid |
| Storage Condition | Keep the receptacle sealed, stored in a cool, dry |
| Packaging | II |
| HTC | 2930909090 |
| MDL Number | MFCD00022058 |
| SMILES | CCOC(=O)c1ccc(N=C=S)cc1 |
| InChI | InChI=1S/C10H9NO2S/c1-2-13-10(12)8-3-5-9(6-4-8)11-7-14/h3-6H,2H2,1H3 |
| InChI Key | MLOJHUCMCKBDLV-UHFFFAOYSA-N |
| Hazard Symbols | 6.1 |
| MSDS | msds/5716_1_1205_06_7.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2930909090. other organo-sulfur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Pharmaceutical Intermediates | ||
|---|---|---|
| 4-Chlorobenzenesulfonyl chloride | 98-60-2 | 2A-9005642 |
| 4-Chlorobenzensulfonyl isocyanate | 5769-15-3 | 2A-9005644 |
| 4-Chlorophenyl isocyanate | 104-21-1 | 2A-9005675 |
| 4-Cyanophenyl isocyanate | 40465-45-0 | 2A-9005702 |
| 4-Dimethlaminophenyl isocyanate | 16315-59-6 | 2A-9005709 |
| 4-Ethoxyphenyl isothiocyanate | 3460-49-9 | 2A-9005718 |
| 4-Hydroxy-2,2,6,6-tetramethyl piperidinyloxy | 2226-96-2 | 2A-9005834 |
| 4-Iodobenzenesulfonyl chloride | 98-61-3 | 2A-9005904 |
| 4-Isopropylphenyl isocyanate | 31027-31-3 | 2A-9005919 |
| 4-Methoxybenzyl isocyanate | 56651-60-6 | 2A-9005932 |
| Browse all Pharmaceutical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA