
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 403646-47-9 |
| Catalog No. | 2A-9057067 |
| Chinese Name | 5-溴-2-(三氟甲氧基)苯甲酸 |
| Synonyms | 5-Bromo-2-(trifluoromethoxy)benzoic acid; 5-bromo-2-trifluoromethoxy-benzoic acid |
| Molecular Formula | C8H4BrF3O3 |
| Molecular Weight | 285.015 |
| Purity | 98.00 |
| Density | 1.8±0.1 g/cm3 |
| Boiling Point | 287.1±40.0 °C at 760 mmHg |
| Storage Condition | room temperature, dry |
| HTC | 2918990090 |
| SMILES | O=C(O)c1cc(Br)ccc1OC(F)(F)F |
| InChI Key | KKBZEPNOWXEZSC-UHFFFAOYSA-N |
| MSDS | msds/57067_1_403646_47_9.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-Phenyl-1H-pyrazol-4-methylamine | 400877-10-3 | 2A-9057054 |
| Ostarine | 401900-40-1 | 2A-9057057 |
| 4-Cyano-2-[[2-(4-fluoro-1-naphthalenyl)-1-oxopropyl]amino]benzenebutanoic acid | 402473-54-5 | 2A-9057059 |
| Telaprevir | 402957-28-2 | 2A-9057065 |
| 2-Bromo-6-(trifluoromethoxy)benzoic acid | 403646-46-8 | 2A-9057066 |
| 6-Bromo-1H-indazol-3-amine | 404827-77-6 | 2A-9057069 |
| Panobinostat | 404950-80-7 | 2A-9057073 |
| Besifloxacin hydrochloride | 405165-61-9 | 2A-9057075 |
| 4-Amino-5-fluoro-3-[5-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]quinolin-2(1H)-one | 405169-16-6 | 2A-9057076 |
| 5-Bromo-2-hydroxynicotinonitrile | 405224-22-8 | 2A-9057079 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA