
CAS Number374537-95-8
SynonymsMethyl 3-[4-(chlorosulfonyl)phenyl]propanoate; methyl 3-(4-chlorosulfonylphenyl)propanoate; Methyl 3-(4-chlorosulfonyl)phenylpropionate; MFCD02093942; Benzenepropanoic acid, 4-(chlorosulfonyl)-, methyl ester
Molecular FormulaC10H11O4Cl1S1
Molecular Weight262.71
Purity98.00%
Density1.3±0.1 g/cm3
Boiling Point352.0±25.0 °C at 760 mmHg
Melting Point64-65ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 374537-95-8 |
| Catalog No. | 2A-9056906 |
| Chinese Name | 3-(4-磺酰氯)苯丙酸甲酯 |
| Synonyms | Methyl 3-[4-(chlorosulfonyl)phenyl]propanoate; methyl 3-(4-chlorosulfonylphenyl)propanoate; Methyl 3-(4-chlorosulfonyl)phenylpropionate; MFCD02093942; Benzenepropanoic acid, 4-(chlorosulfonyl)-, methyl ester |
| Molecular Formula | C10H11O4Cl1S1 |
| Molecular Weight | 262.71 |
| Purity | 98.00 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 352.0±25.0 °C at 760 mmHg |
| Melting Point | 64-65ºC |
| Storage Condition | Storage method: airtight, cool, ventilated and dry |
| Packaging | II |
| HTC | 2916399090 |
| MDL Number | MFCD02093942 |
| SMILES | COC(=O)CCc1ccc(S(=O)(=O)Cl)cc1 |
| InChI Key | MLBUSWRSGABXFY-UHFFFAOYSA-N |
| MSDS | msds/56906_1_374537_95_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Sontuzumab | 372075-37-1 | 2A-9056886 |
| 1,1,2,3-Ttetramethyl-1H-benz[e]indolium hexafluorophosphate(1-) (1:1) | 372081-65-7 | 2A-9056887 |
| PIK 75 | 372196-67-3 | 2A-9056891 |
| N-(4-Cyanophenyl)guanidine hydrochloride | 373690-68-7 | 2A-9056900 |
| 1-Pyridin-4-ylbutane-1,4-diamine | 374064-03-6 | 2A-9056903 |
| Potassium (4-formylphenyl)trifluoroborate | 374564-36-0 | 2A-9056912 |
| N4,N4'-Di-1-naphthalenyl-N4,N4'-di-2-naphthalenyl-[1,1'-biphenyl]-4,4'-diamine | 374592-88-8 | 2A-9056913 |
| 2-Chloro-3-fluoro-6-picoline | 374633-32-6 | 2A-9056915 |
| Mandipropamid | 374726-62-2 | 2A-9056920 |
| Bertilimumab | 375348-49-5 | 2A-9056928 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA