
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1073-69-4 |
| Catalog No. | 2A-9005679 |
| Chinese Name | 4-氯苯肼 |
| Synonyms | MFCD00038132; (4-Chlorophenyl)hydrazine hydrochloride; EINECS 214-029-3; (4-Chlorophenyl)hydrazine; 4-Chlorophenylhydrazine |
| Molecular Formula | C6H7N2Cl1 |
| Molecular Weight | 142.59 |
| Purity | 98 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 265.3±23.0 °C at 760 mmHg |
| Storage Condition | Room temperature, dry |
| HTC | 2928000090 |
| MDL Number | MFCD00038132 |
| SMILES | NNc1ccc(Cl)cc1 |
| InChI | InChI=1S/C6H7ClN2.ClH/c7-5-1-3-6(9-8)4-2-5;/h1-4,9H,8H2;1H |
| InChI Key | XXNOGQJZAOXWAQ-UHFFFAOYSA-N |
| MSDS | msds/5679_1_1073_69_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Chloroiodobenzene | 637-87-6 | 2A-9005662 |
| 4-Chloromandelic acid | 492-86-4 | 2A-9005664 |
| 4-Chloro-N-(2-oxo-tetrahydrothiophen-3-yl)benzamide | 2A-105672 | 2A-9005672 |
| 4-Chloro-N-(4-methoxybenzyl)-2-(trifluoroacetyl)aniline | 173676-54-5 | 2A-9005673 |
| 4-Chlorophenylacetyl chloride | 25026-34-0 | 2A-9005677 |
| 4-Chlorophenylpropionic acid | 2019-34-3 | 2A-9005681 |
| 4-Chloropropiophenone | 6285-05-8 | 2A-9005684 |
| 4'-Chlorovalerophenone | 25017-08-7 | 2A-9005687 |
| 4-Cyano-2-fluorobenzoic acid | 164149-28-4 | 2A-9005690 |
| 4-Cyano-3,5-difluorophenol | 123843-57-2 | 2A-9005692 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA