
CAS Number25026-34-0
Synonyms4-chlorophenylacetic acid chloride; parachlorophenyl acetyl chloride; 4-Chlorobenzeneacetyl chloride; MFCD00037111; EINECS 246-571-1; p-chlorophenylacetyl chloride; 4-Chlorophenylacetyl chloride; (4-Chlorophenyl)acetyl chloride
Molecular FormulaC8H6O1Cl2
Molecular Weight189.04
Purity98%
Density1.3±0.1 g/cm3
Boiling Point254.7±23.0 °C at 760 mmHg
AppearanceTransparent yellow to brown liquid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 25026-34-0 |
| Catalog No. | 2A-9005677 |
| Chinese Name | 对氯苯乙酰氯 |
| Synonyms | 4-chlorophenylacetic acid chloride; parachlorophenyl acetyl chloride; 4-Chlorobenzeneacetyl chloride; MFCD00037111; EINECS 246-571-1; p-chlorophenylacetyl chloride; 4-Chlorophenylacetyl chloride; (4-Chlorophenyl)acetyl chloride |
| Molecular Formula | C8H6O1Cl2 |
| Molecular Weight | 189.04 |
| Purity | 98 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 254.7±23.0 °C at 760 mmHg |
| Appearance | Transparent yellow to brown liquid |
| Storage Condition | Dispose under dry protective gas, Keep receptacles |
| Packaging | II |
| HTC | 2916399090 |
| MDL Number | MFCD00037111 |
| SMILES | O=C(Cl)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C8H6Cl2O/c9-7-3-1-6(2-4-7)5-8(10)11/h1-4H,5H2 |
| InChI Key | UMQUIRYNOVNYPA-UHFFFAOYSA-N |
| Hazard Symbols | 8 |
| MSDS | msds/5677_1_25026_34_0.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Chloro-D-phenylalanine | 14091-08-8 | 2A-9005659 |
| 4-Chloroiodobenzene | 637-87-6 | 2A-9005662 |
| 4-Chloromandelic acid | 492-86-4 | 2A-9005664 |
| 4-Chloro-N-(2-oxo-tetrahydrothiophen-3-yl)benzamide | 2A-105672 | 2A-9005672 |
| 4-Chloro-N-(4-methoxybenzyl)-2-(trifluoroacetyl)aniline | 173676-54-5 | 2A-9005673 |
| 4-Chlorophenylhydrazine | 1073-69-4 | 2A-9005679 |
| 4-Chlorophenylpropionic acid | 2019-34-3 | 2A-9005681 |
| 4-Chloropropiophenone | 6285-05-8 | 2A-9005684 |
| 4'-Chlorovalerophenone | 25017-08-7 | 2A-9005687 |
| 4-Cyano-2-fluorobenzoic acid | 164149-28-4 | 2A-9005690 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA