
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 314041-08-2 |
| Catalog No. | 2A-9056505 |
| Chinese Name | 鞣花酸水合物 |
| Synonyms | Ellagic acid hydrate 10GR; MFCD00149494; EINECS 207-508-3; Ellagic acid hydrate |
| Molecular Formula | C14H8O9 |
| Molecular Weight | 302.19 (anhydrous basis) |
| Purity | 98.00 |
| Boiling Point | 871.2ºC at 760 mmHg |
| Melting Point | >300 °C (lit.) |
| Appearance | powder |
| Storage Condition | Keep container sealed and store in a cool, dry pla |
| Application | Ellagic acid hydrate is a natural antioxidant and a potent, ATP-competitive CK2 inhibitor with IC50 and Ki values of 40 nM and 20 nM respectively. |
| PubChem ID | 24863160 |
| MDL Number | MFCD01457347 |
| SMILES | O.Oc1cc2C(=O)Oc3c(O)c(O)cc4C(=O)Oc(c1O)c2-c34 |
| InChI | 1S/C14H6O8.H2O/c15-5-1-3-7-8-4(14(20)22-11(7)9(5)17)2-6(16)10(18)12(8)21-13(3)19;/h1-2,15-18H;1H2 |
| InChI Key | UOZZJRXBNGVIKO-UHFFFAOYSA-N |
| NACRES Code | NA.23 |
| UNSPSC | 12162002 |
| MSDS | msds/56505_1_314041_08_2.pdf |
| Transport Info | Product name: Ellagic acid hydrate |
| Related Products in Botanical Reference Standards | ||
|---|---|---|
| (E)-4,4'-Bis(diphenylamino)stilbene | 202748-68-3 | 2A-9055252 |
| 4-Aminophenyl 2-acetamido-2-deoxy-alpha-D-galactopyranoside hydrochloride | 210049-16-4 | 2A-9055488 |
| (+)-Catechin hydrate | 225937-10-0 | 2A-9055832 |
| 2-Methylphenyl 2-acetamido-2-deoxy-beta-D-glucopyranoside | 263746-45-8 | 2A-9056154 |
| Cyclopropylmethyl beta-D-glucopyranoside | 284039-66-3 | 2A-9056297 |
| Cholesterol-3-13C | 334974-05-9 | 2A-9056648 |
| 7alpha-Hydroxycholesterol-25,26,26,26-27,27,27-D7 | 349553-94-2 | 2A-9056738 |
| 7beta-Hydroxycholesterol-25,26,26,26-27,27,27-D7 | 349553-97-5 | 2A-9056740 |
| cis-Pterostilbene | 441351-32-2 | 2A-9057200 |
| 2-Pyridinylmethyl beta-D-glucopyranoside | 679412-99-8 | 2A-9057895 |
| Browse all Botanical Reference Standards products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA