
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 6833-15-4 |
| Catalog No. | 2A-9005640 |
| Chinese Name | 4-氯苯-N-苯甲酰苯胺 |
| Synonyms | 4-chloro-N-phenylbenzamide |
| Molecular Formula | C13H10ClNO |
| Molecular Weight | 231.67800 |
| Purity | 98 |
| Density | 1.285g/cm3 |
| Boiling Point | 288.6ºC at 760 mmHg |
| Melting Point | 199-201ºC(lit.) |
| Appearance | White to gray crystalline powder |
| Storage Condition | Room Temperature |
| HTC | 2924299090 |
| SMILES | O=C(Nc1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H10ClNO/c14-11-8-6-10(7-9-11)13(16)15-12-4-2-1-3-5-12/h1-9H,(H,15,16) |
| InChI Key | SFHDVPIEJXCMBP-UHFFFAOYSA-N |
| MSDS | msds/5640_1_6833_15_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Chloro-3-sulfamoylbenzoic acid | 1205-30-7 | 2A-9005616 |
| 4'-Chloro-4-fluoro-3-nitrobenzophenone | 31431-16-0 | 2A-9005618 |
| 4-Chloro-4'-methoxybutyrophenone | 40877-19-8 | 2A-9005619 |
| 4-Chloro-4'-nitrobenzophenone | 7497-60-1 | 2A-9005620 |
| 4-Chloro-5-chlorosulfonyl-2-fluorobenzoic acid | 56447-54-2 | 2A-9005623 |
| 4-Chloro-benzenesulfonic acid | 98-66-8 | 2A-9005641 |
| 4-Chlorobenzonitrile | 623-03-0 | 2A-9005645 |
| 4-Chlorobenzothiazolone | 39205-62-4 | 2A-9005646 |
| 4-Chlorobenzyl bromide | 622-95-7 | 2A-9005648 |
| 4-Chlorobenzylamine | 104-86-9 | 2A-9005649 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA