
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 7497-60-1 |
| Catalog No. | 2A-9005620 |
| Chinese Name | (4-氯苯基)(4-硝基苯基)甲酮 |
| Synonyms | 4-Chloro-4'-nitrobenzophenone; 4'-nitro-4-chlorobenzophenone; MFCD00047743 |
| Molecular Formula | C13H8ClNO3 |
| Molecular Weight | 261.66100 |
| Purity | 98 |
| Density | 1.367 g/cm3 |
| Boiling Point | 425.9ºC at 760 mmHg |
| Storage Condition | 2-8°C |
| HTC | 2914700090 |
| SMILES | O=C(c1ccc(Cl)cc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H8ClNO3/c14-11-5-1-9(2-6-11)13(16)10-3-7-12(8-4-10)15(17)18/h1-8H |
| InChI Key | CLFRUWPJQKSRRT-UHFFFAOYSA-N |
| MSDS | msds/5620_1_7497_60_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Chloro-3-phenylenediamine | 5131-60-2 | 2A-9005612 |
| 4-Chloro-3-phenylpyridazin-6-ol | 51660-08-3 | 2A-9005613 |
| 4-Chloro-3-sulfamoylbenzoic acid | 1205-30-7 | 2A-9005616 |
| 4'-Chloro-4-fluoro-3-nitrobenzophenone | 31431-16-0 | 2A-9005618 |
| 4-Chloro-4'-methoxybutyrophenone | 40877-19-8 | 2A-9005619 |
| 4-Chloro-5-chlorosulfonyl-2-fluorobenzoic acid | 56447-54-2 | 2A-9005623 |
| 4-Chlorobenzanilide | 6833-15-4 | 2A-9005640 |
| 4-Chloro-benzenesulfonic acid | 98-66-8 | 2A-9005641 |
| 4-Chlorobenzonitrile | 623-03-0 | 2A-9005645 |
| 4-Chlorobenzothiazolone | 39205-62-4 | 2A-9005646 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA