
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 289499-45-2 |
| Catalog No. | 2A-9056356 |
| Chinese Name | 卡纽替尼二盐酸盐 |
| Synonyms | Canertinib dihydrochloride; Canertinib HCl; CI103; Canertinib (dihydrochloride) |
| Molecular Formula | C24H27Cl3FN5O3 |
| Molecular Weight | 558.86 |
| Purity | ≥98 (HPLC) |
| Density | 1.355g/cm3 |
| Boiling Point | 691ºC at 760mmHg |
| Melting Point | 188-190℃ |
| Appearance | solid |
| Water Solubility | DMSO: >10mg/mL |
| Storage Condition | ?20°C |
| Application | Canertinib dihydrochloride (CI-1033; PD-183805) is a potent, irreversible EGFR inhibitor; inhibiting cellular EGFR and ErbB2 autophosphorylation with IC50 values of 7.4 and 9 nM, respectively. |
| PubChem ID | 329775143 |
| MDL Number | MFCD09954112 |
| SMILES | Cl.Cl.Fc1ccc(Nc2ncnc3cc(OCCCN4CCOCC4)c(NC(=O)C=C)cc23)cc1Cl |
| InChI | 1S/C24H25ClFN5O3.2ClH/c1-2-23(32)30-21-13-17-20(14-22(21)34-9-3-6-31-7-10-33-11-8-31)27-15-28-24(17)29-16-4-5-19(26)18(25)12-16;;/h2,4-5,12-15H,1,3,6-11H2,(H,30,32)(H,27,28,29);2*1H |
| InChI Key | JZZFDCXSFTVOJY-UHFFFAOYSA-N |
| NACRES Code | NA.77 |
| UNSPSC | 51111800 |
| MSDS | msds/56356_1_289499_45_2.pdf |
| Transport Info | Product Name: Canertinib dihydrochloride |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| (2S)-2-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-2-methyl-9-decenoic acid | 288617-75-4 | 2A-9056347 |
| (2R)-2-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-2-methyl-6-heptenoic acid | 288617-77-6 | 2A-9056348 |
| 2-Chloro-5-iodobenzonitrile | 289039-29-8 | 2A-9056350 |
| 3-Chloro-5-iodobenzonitrile | 289039-30-1 | 2A-9056351 |
| N-[5-(Diphenylphosphinoylmethyl)-4-(4-fluorophenyl)-6-isopropylpyrimidin-2-yl]-N-methylmethanesulfonamide | 289042-10-0 | 2A-9056352 |
| Senicapoc | 289656-45-7 | 2A-9056357 |
| 5-(3-Methoxyphenyl)-4H-1,2,4-triazol-3-amine | 289710-96-9 | 2A-9056358 |
| Netupitant | 290297-26-6 | 2A-9056359 |
| N-Methyl-1-[3,5-bis(trifluoomethyl)phenyl]ethylamine | 290297-43-7 | 2A-9056360 |
| Acetyl-tyrosyl-(N-methyl)valyl-alanyl-(N-methyl)aspartal | 290814-90-3 | 2A-9056362 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA