
CAS Number284030-58-6
Synonyms4-amino-2,3-difluoro-5-nitro-benzoic acid methyl ester; Methyl 4-amino-2,3-difluoro-5-nitrobenzoate; methyl 2,3-difluoro-4-amino-5-nitro-benzoate; Benzoic acid, 4-amino-2,3-difluoro-5-nitro-, methyl ester
Molecular FormulaC8H6F2N2O4
Molecular Weight232.141
Purity98.00%
Density1.5±0.1 g/cm3
Boiling Point402.0±45.0 °C at 760 mmHg
Melting Point184-186ºC
AppearanceLight yellow to yellowish brown solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 284030-58-6 |
| Catalog No. | 2A-9056295 |
| Chinese Name | 4-氨基-2,3-二氟-5-硝基苯甲酸甲酯 |
| Synonyms | 4-amino-2,3-difluoro-5-nitro-benzoic acid methyl ester; Methyl 4-amino-2,3-difluoro-5-nitrobenzoate; methyl 2,3-difluoro-4-amino-5-nitro-benzoate; Benzoic acid, 4-amino-2,3-difluoro-5-nitro-, methyl ester |
| Molecular Formula | C8H6F2N2O4 |
| Molecular Weight | 232.141 |
| Purity | 98.00 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 402.0±45.0 °C at 760 mmHg |
| Melting Point | 184-186ºC |
| Appearance | Light yellow to yellowish brown solid |
| Storage Condition | Room temperature, protected from light, inert gas |
| SMILES | COC(=O)c1cc([N+](=O)[O-])c(N)c(F)c1F |
| InChI Key | HOJFIOHGPQOQBF-UHFFFAOYSA-N |
| Transport Info | Product name: Methyl 4-amino-2,3-difluoro-5-nitrobenzoate |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| (5R,6S)-5,6-Diphenyl-2-morpholinone | 282735-66-4 | 2A-9056288 |
| (3S)-3-(9H-Fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-[tri(phenyl)methylamino]pentanoic acid | 283160-20-3 | 2A-9056290 |
| 5-Fluoro-3-hydrazonoindolin-2-one | 283584-52-1 | 2A-9056292 |
| Denibulin | 284019-34-7 | 2A-9056293 |
| 4-Amino-2,3-difluoro-5-nitrobenzoic acid | 284030-57-5 | 2A-9056294 |
| 2-Chloro-6-[(2R)-3-[[1,1-dimethyl-2-(2-naphthalenyl)ethyl]amino]-2-hydroxypropoxy]benzonitrile | 284035-33-2 | 2A-9056296 |
| 4-(4-Aminophenoxy)-N-methylpicolinamide | 284462-37-9 | 2A-9056299 |
| Doramapimod | 285983-48-4 | 2A-9056307 |
| 5-tert-Butyl-2-p-tolyl-2H-pyrazol-3-ylamine | 285984-25-0 | 2A-9056308 |
| 2-(4-Pyridinyl)-4-thiazolol | 285995-73-5 | 2A-9056309 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA