CAS Number176976-42-4
SynonymsMFCD03094999; 4-Chloro-3-(trifluoromethyl)phenylboronic Acid; 4-Chloro-3-(trifluoromethyl)benzeneboronic Acid; [4-Chloro-3-(trifluoromethyl)phenyl]boronic acid; 4-Chloro-3-(trifluoromethyl)phenyl Boronic acid
Molecular FormulaC7H5O2Cl1F3B1
Molecular Weight224.37
Purity98%
Density1.5±0.1 g/cm3
Boiling Point304.3±52.0 °C at 760 mmHg
Melting Point135-137 °C(lit.)
AppearanceSolid;White to Almost white powder to crystal
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 176976-42-4 |
| Catalog No. | 2A-9005586 |
| Chinese Name | 4-氯-3-(三氟甲基)苯硼酸 |
| Synonyms | MFCD03094999; 4-Chloro-3-(trifluoromethyl)phenylboronic Acid; 4-Chloro-3-(trifluoromethyl)benzeneboronic Acid; [4-Chloro-3-(trifluoromethyl)phenyl]boronic acid; 4-Chloro-3-(trifluoromethyl)phenyl Boronic acid |
| Molecular Formula | C7H5O2Cl1F3B1 |
| Molecular Weight | 224.37 |
| Purity | 98 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 304.3±52.0 °C at 760 mmHg |
| Melting Point | 135-137 °C(lit.) |
| Appearance | Solid;White to Almost white powder to crystal |
| Water Solubility | freely soluble |
| Storage Condition | Storage: Sealed, cool, ventilated and dry |
| HTC | 2931900090 |
| MDL Number | MFCD03094999 |
| SMILES | OB(O)c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C7H5BClF3O2/c9-6-2-1-4(8(13)14)3-5(6)7(10,11)12/h1-3,13-14H |
| InChI Key | XHKNQBNGLMOTDB-UHFFFAOYSA-N |
| MSDS | msds/5586_1_176976_42_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | AB (Inbound cargo customs clearance form) |
| Transport Info | Product name: Purity: 97.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 4-Chloro-2,5-difluorobenzaldehyde | 2A-105556 | 2A-9005556 |
| 4-Chloro-2-fluorobenzaldehyde | 61072-56-8 | 2A-9005566 |
| 4'-Chloro-3'-(trifluoromethyl)acetophenone | 129825-11-2 | 2A-9005583 |
| 4-Chloro-3-(trifluoromethyl)anisole | 400-73-7 | 2A-9005584 |
| 4-Chloro-3-(trifluoromethyl)benzaldehyde | 34328-46-6 | 2A-9005585 |
| 4-Chloro-3-(trifluoromethyl)benzyl amine | 62039-92-3 | 2A-9005587 |
| 4-Chloro-3-fluorophenylboronic acid | 137504-86-0 | 2A-9005597 |
| 4-Chloro-3-methylphenylboronic acid | 161950-10-3 | 2A-9005602 |
| 4-Chloro-3-nitrobenzaldehyde | 16588-34-4 | 2A-9005606 |
| 4-Chloro-3-trifluoromethylbenzonitrile | 1735-54-2 | 2A-9005617 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS