
CAS Number129825-11-2
Synonyms1-[4-Chloro-3-(trifluoromethyl)phenyl]ethanone; MFCD03094146; 5-Acetyl-2-chlorobenzotrifluoride; FXFFR BG EV1
Molecular FormulaC9H6ClF3O
Molecular Weight222.59
Purity97%
Density1.3±0.1 g/cm3
Boiling Point236.6±35.0 °C at 760 mmHg
Melting Point61-63°C
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 129825-11-2 |
| Catalog No. | 2A-9005583 |
| Chinese Name | 4'-氯-3'-(三氟甲基)乙酰苯 |
| Synonyms | 1-[4-Chloro-3-(trifluoromethyl)phenyl]ethanone; MFCD03094146; 5-Acetyl-2-chlorobenzotrifluoride; FXFFR BG EV1 |
| Molecular Formula | C9H6ClF3O |
| Molecular Weight | 222.59 |
| Purity | 97 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 236.6±35.0 °C at 760 mmHg |
| Melting Point | 61-63°C |
| Appearance | solid |
| Storage Condition | Keep the receptacle sealed, stored in a cool, dry |
| Packaging | I |
| HTC | 2914700090 |
| PubChem ID | 329786460 |
| MDL Number | MFCD03094146 |
| SMILES | CC(=O)c1ccc(Cl)c(c1)C(F)(F)F |
| InChI | 1S/C9H6ClF3O/c1-5(14)6-2-3-8(10)7(4-6)9(11,12)13/h2-4H,1H3 |
| InChI Key | UYNMUXTXDHJBEN-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352200 |
| MSDS | msds/5583_1_129825_11_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 4-Bromophenyl trifluoromethyl sulphide | 333-47-1 | 2A-9005528 |
| 4'-Butylbiphenyl-4-carboxylic acid | 59662-46-3 | 2A-9005536 |
| 4-Chloro-2-(trifluoromethyl)benzaldehyde | 320-43-4 | 2A-9005550 |
| 4-Chloro-2,5-difluorobenzaldehyde | 2A-105556 | 2A-9005556 |
| 4-Chloro-2-fluorobenzaldehyde | 61072-56-8 | 2A-9005566 |
| 4-Chloro-3-(trifluoromethyl)anisole | 400-73-7 | 2A-9005584 |
| 4-Chloro-3-(trifluoromethyl)benzaldehyde | 34328-46-6 | 2A-9005585 |
| 4-Chloro-3-(trifluoromethyl)benzeneboronic acid | 176976-42-4 | 2A-9005586 |
| 4-Chloro-3-(trifluoromethyl)benzyl amine | 62039-92-3 | 2A-9005587 |
| 4-Chloro-3-fluorophenylboronic acid | 137504-86-0 | 2A-9005597 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA