
CAS Number5202-86-8
Synonyms4-chloro-2-methylacetanilide; EINECS 225-991-9; Essigsaeure-(4-chlor-2-methyl-anilid); 4'-Chlor-2'-methylacetanilid; acetic acid-(4-chloro-2-methyl-anilide); MFCD00027399; 4'-CHLORO-2'-METHYLACETANILIDE; 5-Chlor-2-acetamino-toluol; N-Acetyl-4-chlor-o-toluidin
Molecular FormulaC9H10ClNO
Molecular Weight183.639
Purity98%
Density1.218 g/cm3
Boiling Point324.3ºC at 760 mmHg
Melting Point136ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5202-86-8 |
| Catalog No. | 2A-9005578 |
| Chinese Name | N-(4-氯-2-甲基苯基)乙酰胺 |
| Synonyms | 4-chloro-2-methylacetanilide; EINECS 225-991-9; Essigsaeure-(4-chlor-2-methyl-anilid); 4'-Chlor-2'-methylacetanilid; acetic acid-(4-chloro-2-methyl-anilide); MFCD00027399; 4'-CHLORO-2'-METHYLACETANILIDE; 5-Chlor-2-acetamino-toluol; N-Acetyl-4-chlor-o-toluidin |
| Molecular Formula | C9H10ClNO |
| Molecular Weight | 183.639 |
| Purity | 98 |
| Density | 1.218 g/cm3 |
| Boiling Point | 324.3ºC at 760 mmHg |
| Melting Point | 136ºC |
| Storage Condition | Keep away from light, cool and dry place, sealed a |
| HTC | 2924299090 |
| MDL Number | MFCD00027399 |
| SMILES | CC(=O)Nc1ccc(Cl)cc1C |
| InChI | InChI=1S/C9H10ClNO/c1-6-5-8(10)3-4-9(6)11-7(2)12/h3-5H,1-2H3,(H,11,12) |
| InChI Key | WMHHXYOPEQARIN-UHFFFAOYSA-N |
| MSDS | msds/5578_1_5202_86_8.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Chloro-2-fluorocinnamic acid | 202982-65-8 | 2A-9005572 |
| 4-Chloro-2-fluoroiodobenzene | 6797-79-1 | 2A-9005573 |
| 4-Chloro-2-fluoronitrobenzene | 700-37-8 | 2A-9005574 |
| 4-Chloro-2-fluorophenol | 348-62-9 | 2A-9005575 |
| 4-Chloro-2-hydroxy-5-sulfamoylbenzoic acid | 14556-98-0 | 2A-9005577 |
| 4'-Chloro-2-methylpropiophenone | 18713-58-1 | 2A-9005579 |
| 4-Chloro-2-nitroaniline | 89-63-4 | 2A-9005580 |
| 4-Chloro-2-nitrobenzoic acid | 6280-88-2 | 2A-9005581 |
| 4-Chloro-2-nitrobenzonitrile | 34662-32-3 | 2A-9005582 |
| 4-Chloro-3,5-diaminobenzotrifluoride | 34207-44-8 | 2A-9005589 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA