
CAS Number202982-65-8
Synonyms(2E)-3-(4-Chloro-2-fluorophenyl)acrylic acid; 4-Chloro-2-fluorocinnamicacid; (E)-3-(4-Chloro-2-fluorophenyl)acrylic acid; (2E)-3-(4-Chloro-2-fluorophenyl)-2-propenoic acid; (E)-3-(4-Chloro-2-fluorophenyl)prop-2-enoic acid; 4-Chloro-2-fluorocinnamic acid; QV1U1R DG BF &&trans or E Form; 3-(4-Chloro-2-fluorophenyl)acrylic acid; MFCD00143287; RARECHEM BK HW 0062; (2E)-3-(4-chloro-2-fluorophenyl)prop-2-enoic acid
Molecular FormulaC9H6ClFO2
Molecular Weight200.594
Purity98%
Density1.4±0.1 g/cm3
Boiling Point316.4±27.0 °C at 760 mmHg
Melting Point213-216ºC(lit.)
AppearanceWhite to light yellow crystal powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 202982-65-8 |
| Catalog No. | 2A-9005572 |
| Chinese Name | 4-氯-2-氟肉桂酸 |
| Synonyms | (2E)-3-(4-Chloro-2-fluorophenyl)acrylic acid; 4-Chloro-2-fluorocinnamicacid; (E)-3-(4-Chloro-2-fluorophenyl)acrylic acid; (2E)-3-(4-Chloro-2-fluorophenyl)-2-propenoic acid; (E)-3-(4-Chloro-2-fluorophenyl)prop-2-enoic acid; 4-Chloro-2-fluorocinnamic acid; QV1U1R DG BF &&trans or E Form; 3-(4-Chloro-2-fluorophenyl)acrylic acid; MFCD00143287; RARECHEM BK HW 0062; (2E)-3-(4-chloro-2-fluorophenyl)prop-2-enoic acid |
| Molecular Formula | C9H6ClFO2 |
| Molecular Weight | 200.594 |
| Purity | 98 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 316.4±27.0 °C at 760 mmHg |
| Melting Point | 213-216ºC(lit.) |
| Appearance | White to light yellow crystal powder |
| Storage Condition | Storage: Sealed, cool, ventilated and dry |
| HTC | 2916399090 |
| SMILES | [O-]C(=O)/C=C/c1ccc(Cl)cc1F |
| InChI | InChI=1S/C9H6ClFO2/c10-7-3-1-6(8(11)5-7)2-4-9(12)13/h1-5H,(H,12,13)/p-1/b4-2+ |
| InChI Key | InChIKey=FVLPOWWRHAOKMT-DUXPYHPUSA-M |
| MSDS | msds/5572_1_202982_65_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 97.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards 4-Chloro-2-fluorocinnamic acid Modification number: 6 Module 14. Shipping information UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Chloro-2-fluorobenzenesulphonyl chloride | 141337-26-0 | 2A-9005567 |
| 4-Chloro-2-fluorobenzoic acid | 446-30-0 | 2A-9005568 |
| 4-Chloro-2-fluorobenzonitrile | 57381-51-8 | 2A-9005569 |
| 4-Chloro-2-fluorobenzotrichloride | 179111-13-8 | 2A-9005570 |
| 4-Chloro-2-fluorobenzotrifluoride | 94444-59-4 | 2A-9005571 |
| 4-Chloro-2-fluoroiodobenzene | 6797-79-1 | 2A-9005573 |
| 4-Chloro-2-fluoronitrobenzene | 700-37-8 | 2A-9005574 |
| 4-Chloro-2-fluorophenol | 348-62-9 | 2A-9005575 |
| 4-Chloro-2-hydroxy-5-sulfamoylbenzoic acid | 14556-98-0 | 2A-9005577 |
| 4-Chloro-2-methylacetanilide | 5202-86-8 | 2A-9005578 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA