CAS Number216019-28-2
Synonyms3-Isopropylphenylboronic Acid; 3-ISOPROPYLBORONIC ACID; (3-Isopropylphenyl)boronic acid; 3-CUMYLBORONIC ACID; 3-Isopropylbenzeneboronic acid; MFCD01074634; 3-Isoprophenylboronic acid; RARECHEM AH PB 0151; 3-Isopropylphebylboronic acid; 3-isopropylphenyl boronic acid; 3-Isopropylphenylboronic; [3-(propan-2-yl)phenyl]boronic acid; M-ISOPROPYLPHENYLBORONIC ACID
Molecular FormulaC9H13O2B1
Molecular Weight164.01
Purity98.00%
Density1.0±0.1 g/cm3
Boiling Point294.2±33.0 °C at 760 mmHg
Melting Point70-72°C
Appearanceoff-white crystal
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 216019-28-2 |
| Catalog No. | 2A-9055633 |
| Chinese Name | 3-异丙基苯硼酸 |
| Synonyms | 3-Isopropylphenylboronic Acid; 3-ISOPROPYLBORONIC ACID; (3-Isopropylphenyl)boronic acid; 3-CUMYLBORONIC ACID; 3-Isopropylbenzeneboronic acid; MFCD01074634; 3-Isoprophenylboronic acid; RARECHEM AH PB 0151; 3-Isopropylphebylboronic acid; 3-isopropylphenyl boronic acid; 3-Isopropylphenylboronic; [3-(propan-2-yl)phenyl]boronic acid; M-ISOPROPYLPHENYLBORONIC ACID |
| Molecular Formula | C9H13O2B1 |
| Molecular Weight | 164.01 |
| Purity | 98.00 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 294.2±33.0 °C at 760 mmHg |
| Melting Point | 70-72°C |
| Appearance | off-white crystal |
| Water Solubility | Soluble in: methanol |
| Storage Condition | Storage method: airtight, cool, ventilated and dry |
| HTC | 2931900090 |
| MDL Number | MFCD01074634 |
| SMILES | CC(C)c1cccc(B(O)O)c1 |
| InChI | InChI=1S/C9H13BO2/c1-7(2)8-4-3-5-9(6-8)10(11)12/h3-7,11-12H,1-2H3 |
| InChI Key | QSWLFBMVIGQONC-UHFFFAOYSA-N |
| MSDS | msds/55633_1_216019_28_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | AB (Inbound cargo customs clearance form) |
| Transport Info | Product name: Purity: 97.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| Thiophene-3-boronic acid pinacol ester | 214360-70-0 | 2A-9055573 |
| 4-Aminophenylboronic acid pinacol ester | 214360-73-3 | 2A-9055574 |
| 2,4,6-Trimethylbenzeneboronic acid neopentyl glycol ester | 214360-78-8 | 2A-9055576 |
| trans-2-(4-Fluorophenyl)vinylboronic acid | 214907-24-1 | 2A-9055598 |
| 1-Aminocyclobutanecarboxylic acid methyl ester hydrochloride | 215597-35-6 | 2A-9055620 |
| 5-Borono-1-naphthalenecarboxylic acid | 216060-11-6 | 2A-9055634 |
| 3,5-Difluorobenzeneboronic acid neopentyl glycol ester | 216393-57-6 | 2A-9055640 |
| 6-(Trifluoromethyl)nicotinonitrile | 216431-85-5 | 2A-9055644 |
| 3-Isopropoxyphenylboronic acid | 216485-86-8 | 2A-9055645 |
| 6-(Trifluoromethyl)pyridin-3-ol | 216766-12-0 | 2A-9055649 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS