
CAS Number214360-78-8
Synonyms2,4,6-Trimethylbenzeneboronic acid neopentyl glycol ester; 2-MESITYL-5,5-DIMETHYL-1,3,2-DIOXABORINANE; MFCD01318178; 2,4,6-trimethylbenzeneboronic acid neopentyl glycol cyclic ester
Molecular FormulaC14H21O2B1
Molecular Weight232.13
Purity98.00%
Density0.98g/cm3
Boiling Point339.9ºC at 760mmHg
Melting Point46-48ºC
AppearanceWhite to light yellow solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 214360-78-8 |
| Catalog No. | 2A-9055576 |
| Chinese Name | 2.4.6-三甲基苯硼酸新戊二醇酯 |
| Synonyms | 2,4,6-Trimethylbenzeneboronic acid neopentyl glycol ester; 2-MESITYL-5,5-DIMETHYL-1,3,2-DIOXABORINANE; MFCD01318178; 2,4,6-trimethylbenzeneboronic acid neopentyl glycol cyclic ester |
| Molecular Formula | C14H21O2B1 |
| Molecular Weight | 232.13 |
| Purity | 98.00 |
| Density | 0.98g/cm3 |
| Boiling Point | 339.9ºC at 760mmHg |
| Melting Point | 46-48ºC |
| Appearance | White to light yellow solid |
| Storage Condition | Storage method: dry, cool and airtight |
| HTC | 2934999090 |
| MDL Number | MFCD01318178 |
| SMILES | Cc1cc(C)c(B2OCC(C)(C)CO2)c(C)c1 |
| InChI Key | ITLDRNGUSKUMRG-UHFFFAOYSA-N |
| MSDS | msds/55576_1_214360_78_8.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 3-Cyano-4-fluorobenzeneboronic acid | 214210-21-6 | 2A-9055565 |
| 1-(2-Chloro-6-fluorophenyl)cyclopentanecarboxylic acid | 214263-03-3 | 2A-9055569 |
| 2-Cyanophenylboronic acid neopentyl ester | 214360-47-1 | 2A-9055572 |
| Thiophene-3-boronic acid pinacol ester | 214360-70-0 | 2A-9055573 |
| 4-Aminophenylboronic acid pinacol ester | 214360-73-3 | 2A-9055574 |
| trans-2-(4-Fluorophenyl)vinylboronic acid | 214907-24-1 | 2A-9055598 |
| 1-Aminocyclobutanecarboxylic acid methyl ester hydrochloride | 215597-35-6 | 2A-9055620 |
| 3-Cumylboronic acid | 216019-28-2 | 2A-9055633 |
| 5-Borono-1-naphthalenecarboxylic acid | 216060-11-6 | 2A-9055634 |
| 3,5-Difluorobenzeneboronic acid neopentyl glycol ester | 216393-57-6 | 2A-9055640 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA