
CAS Number214353-17-0
Synonyms2-Amino-5-chlorophenyl-2,2,2-trifluoroethanone; 2-[5-chloro-2-(hydroxyaMino)phenyl]-2,2-difluoroacetyl fluoride hydrochloride; 1,1-ETHANEDIOL,1-(2-AMINO-5-CHLOROPHENYL)-2,2,2-TRIFLUORO-,HYDROCHLORIDE; 2-TRIFLUOROACETYL-4-CHLORO ANILINE; 4-Chloro-2-trifluoroacetoaniline hydrochloride hydrate; Efavirinz intermediate
Molecular FormulaC15H16Cl4F3N3OS
Molecular Weight485.185
Purity98.00%
Density1.624g/cm3
Boiling Point381.771ºC at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 214353-17-0 |
| Catalog No. | 2A-9055571 |
| Chinese Name | 2'-氨基-5'-氯-2,2,2-三氟苯乙酮 |
| Synonyms | 2-Amino-5-chlorophenyl-2,2,2-trifluoroethanone; 2-[5-chloro-2-(hydroxyaMino)phenyl]-2,2-difluoroacetyl fluoride hydrochloride; 1,1-ETHANEDIOL,1-(2-AMINO-5-CHLOROPHENYL)-2,2,2-TRIFLUORO-,HYDROCHLORIDE; 2-TRIFLUOROACETYL-4-CHLORO ANILINE; 4-Chloro-2-trifluoroacetoaniline hydrochloride hydrate; Efavirinz intermediate |
| Molecular Formula | C15H16Cl4F3N3OS |
| Molecular Weight | 485.185 |
| Purity | 98.00 |
| Density | 1.624g/cm3 |
| Boiling Point | 381.771ºC at 760 mmHg |
| HTC | 2922199090 |
| MDL Number | MFCD00361310 |
| SMILES | Cl.Nc1ccc(Cl)cc1C(O)(O)C(F)(F)F |
| InChI Key | SYLRXHNMJUPJDK-UHFFFAOYSA-N |
| MSDS | msds/55571_1_214353_17_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-Amino-2-methylpropionic acid hydrate | 214139-20-5 | 2A-9055562 |
| 1-Acetylpiperidin-4-amine hydrochloride | 214147-48-5 | 2A-9055563 |
| 4-Bromo-2-fluorobenzenesulfonamide | 214210-30-7 | 2A-9055566 |
| Ethyl 2-chloro-6-fluorophenylacetate | 214262-85-8 | 2A-9055568 |
| 5-Chloro-2-pyrimidinol | 214290-50-3 | 2A-9055570 |
| 2-Amino-4-(2-chloroethoxy)-5-methoxybenzoic acid methyl ester | 214470-60-7 | 2A-9055577 |
| 3-[(1R)-3-[Bis(1-methylethyl)amino]-1-phenylpropyl]-4-hydroxybenzoic acid methyl ester hydrochloride | 214600-45-0 | 2A-9055578 |
| 3-[(1R)-3-[Bis(1-methylethyl)amino]-1-phenylpropyl]-4-hydroxybenzoic acid methyl ester | 214601-17-9 | 2A-9055579 |
| 3-Butyl-2-[3-(1,3-dihydro-1,3,3-trimethyl-2H-indol-2-ylidene)-1-propen-1-yl]-1,1-dimethyl-1H-benz[e]indolium perchlorate | 214706-06-6 | 2A-9055581 |
| (4-Piperidinophenyl)methylamine | 214759-73-6 | 2A-9055589 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA