
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 214262-85-8 |
| Catalog No. | 2A-9055568 |
| Chinese Name | 2-氯-6-氟苯乙酸乙酯 |
| Synonyms | MFCD00800606; Ethyl 2-Chloro-6-fluorophenylacetate |
| Molecular Formula | C10H10O2Cl1F1 |
| Molecular Weight | 216.64 |
| Purity | 98.00 |
| Density | 1.238 g/cm3 |
| Boiling Point | 254.6ºC at 760 mmHg |
| Appearance | Transparent colorless to light yellow liquid |
| Storage Condition | Sealed in a cool, dry environment at 0-6 ºC |
| HTC | 2916399090 |
| MDL Number | MFCD00800606 |
| SMILES | CCOC(=O)Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C10H10ClFO2/c1-2-14-10(13)6-7-8(11)4-3-5-9(7)12/h3-5H,2,6H2,1H3 |
| InChI Key | CEWCLHPMDWPDNQ-UHFFFAOYSA-N |
| MSDS | msds/55568_1_214262_85_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Camtobell hydrochloride | 213819-48-8 | 2A-9055560 |
| N2-(1-Oxohexadecyl)-L-lysyl-L-threonyl-L-threonyl-L-lysyl-L-serine | 214047-00-4 | 2A-9055561 |
| 3-Amino-2-methylpropionic acid hydrate | 214139-20-5 | 2A-9055562 |
| 1-Acetylpiperidin-4-amine hydrochloride | 214147-48-5 | 2A-9055563 |
| 4-Bromo-2-fluorobenzenesulfonamide | 214210-30-7 | 2A-9055566 |
| 5-Chloro-2-pyrimidinol | 214290-50-3 | 2A-9055570 |
| 2'-Amino-5'-chloro-2,2,2-trifluoroacetophenone | 214353-17-0 | 2A-9055571 |
| 2-Amino-4-(2-chloroethoxy)-5-methoxybenzoic acid methyl ester | 214470-60-7 | 2A-9055577 |
| 3-[(1R)-3-[Bis(1-methylethyl)amino]-1-phenylpropyl]-4-hydroxybenzoic acid methyl ester hydrochloride | 214600-45-0 | 2A-9055578 |
| 3-[(1R)-3-[Bis(1-methylethyl)amino]-1-phenylpropyl]-4-hydroxybenzoic acid methyl ester | 214601-17-9 | 2A-9055579 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA