![(2R)-2-[[6-[(3-Chloro-4-carboxyphenyl)amino]-9-(1-methylethyl)-9H-purin-2-yl]amino]-3-methyl-1-butanol structure, CAS 212844-54-7](/structures/60000/55542_1_212844_54_7.png)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 212844-54-7 |
| Catalog No. | 2A-9055542 |
| Chinese Name | Purvalanol B. |
| Synonyms | Purvalanol B; ng 95 |
| Molecular Formula | C20H25ClN6O3 |
| Molecular Weight | 432.91 |
| Purity | 98.00 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 660.6±65.0 °C at 760 mmHg |
| Storage Condition | 2-8℃ |
| Application | Purvalanol B (NG-95) is a CDK inhibitor with IC50s of 6, 6, 9, > 10000 and 6 nM for cdc2/cyclin B, cdk2/cyclin A, cdk2/cyclin E, cdk4/cyclin D1 and cdk5-p35 respectively. |
| MDL Number | C20H25ClN6O3 |
| SMILES | CC(C)C(CO)Nc1nc(Nc2ccc(C(=O)O)c(Cl)c2)c2ncn(C(C)C)c2n1 |
| InChI Key | ZKDXRFMOHZVXSG-HNNXBMFYSA-N |
| MSDS | msds/55542_1_212844_54_7.pdf |
| Transport Info | Product Name: Purvalanol B |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-[(3-Amino-4-methylaminobenzoyl)pyridin-2-ylamino]propionic acid ethyl ester | 212322-56-0 | 2A-9055532 |
| N,N,N',N'-Tetramethyl-S-(1-oxido-2-pyridyl)thiuronium hexafluorophosphate | 212333-72-7 | 2A-9055533 |
| PD 184352 | 212631-79-3 | 2A-9055536 |
| Ramage Linker | 212783-75-0 | 2A-9055540 |
| D-(-)-2-Chlorophenylglycine methyl ester hydrochloride | 212838-70-5 | 2A-9055541 |
| 2-[2-[2-Chloro-3-[2-(1,3-dihydro-1,3,3-trimethyl-2H-indol-2-ylidene)ethylidene]-1-cyclohexen-1-yl]ethenyl]-1,3,3-trimethyl-3H-indolium bromide | 212964-63-1 | 2A-9055543 |
| Orthosulfamuron | 213464-77-8 | 2A-9055552 |
| 3-Chloro-4-isopropoxybenzoic acid | 213598-07-3 | 2A-9055554 |
| Methyl 3-bromo-4-isopropoxybenzoate | 213598-10-8 | 2A-9055555 |
| 3-Chloro-4-ethoxybenzoic acid | 213598-15-3 | 2A-9055556 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA