
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 208173-22-2 |
| Catalog No. | 2A-9055434 |
| Chinese Name | 2',3',6'-三氟苯乙酮 |
| Synonyms | 1-(2,3,6-Trifluorophenyl)ethanone; MFCD00070809; 1-acetyl-2,3,6-trifluorobenzene; FR BF DF CV1 |
| Molecular Formula | C8H5O1F3 |
| Molecular Weight | 174.12 |
| Purity | 98.00 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 187.2±35.0 °C at 760 mmHg |
| Storage Condition | room temperature |
| Packaging | III |
| HTC | 2914700090 |
| MDL Number | MFCD00070809 |
| SMILES | CC(=O)c1c(F)ccc(F)c1F |
| InChI | InChI=1S/C8H5F3O/c1-4(12)7-5(9)2-3-6(10)8(7)11/h2-3H,1H3 |
| InChI Key | INDGVPJYDRJJPJ-UHFFFAOYSA-N |
| MSDS | msds/55434_1_208173_22_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2,5-Dimethoxy-4-(ethylthio)phenethylamine | 207740-24-7 | 2A-9055413 |
| 2,3,4-Trifluorocinnamic acid | 207742-85-6 | 2A-9055417 |
| Mitiglinide calcium | 207844-01-7 | 2A-9055421 |
| Chloro-N,N,N',N'-tetramethylformamidinium hexafluorophosphate | 207915-99-9 | 2A-9055424 |
| 2,3-Difluoromandelic acid | 207974-19-4 | 2A-9055425 |
| 2,4-O-(3,4-Dimethylbenzylidene)-D-sorbitol | 208462-99-1 | 2A-9055440 |
| Mesosulfuron-methyl | 208465-21-8 | 2A-9055441 |
| 4-(1H-Pyrazol-5-yl)benzoic acid | 208511-67-5 | 2A-9055442 |
| 4-Chloroquinazolin-6-ylamine | 208533-37-3 | 2A-9055445 |
| 3-Bromo-4-isobutoxybenzonitrile | 208665-95-6 | 2A-9055446 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA