
CAS Number207974-19-4
Synonyms(2,3-Difluorophenyl)(hydroxy)acetic acid; 2,3-DI-O-ACETYL-5'-DEOXY-5-FLUORO-N-[(2-METHYLBUTOXY)CARBONYL]CYTIDINE; MFCD00061295; 2,3-difluoromandelic acid
Molecular FormulaC8H6F2O3
Molecular Weight188.12800
Purity98.00%
Density1.522g/cm3
Boiling Point313.3ºC at 760mmHg
Melting Point110-113°C
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 207974-19-4 |
| Catalog No. | 2A-9055425 |
| Chinese Name | 2,3-二氟苯基乙醇酸 |
| Synonyms | (2,3-Difluorophenyl)(hydroxy)acetic acid; 2,3-DI-O-ACETYL-5'-DEOXY-5-FLUORO-N-[(2-METHYLBUTOXY)CARBONYL]CYTIDINE; MFCD00061295; 2,3-difluoromandelic acid |
| Molecular Formula | C8H6F2O3 |
| Molecular Weight | 188.12800 |
| Purity | 98.00 |
| Density | 1.522g/cm3 |
| Boiling Point | 313.3ºC at 760mmHg |
| Melting Point | 110-113°C |
| Storage Condition | Storage method: airtight, cool, ventilated and dry |
| HTC | 2918199090 |
| SMILES | O=C(O)C(O)c1cccc(F)c1F |
| InChI | InChI=1S/C8H6F2O3/c9-5-3-1-2-4(6(5)10)7(11)8(12)13/h1-3,7,11H,(H,12,13) |
| InChI Key | LBJOAPZLJUKPRG-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Dipyrrolidino(N-succinimidyloxy)carbenium hexafluorophosphate | 207683-26-9 | 2A-9055411 |
| 2,5-Dimethoxy-4-(ethylthio)phenethylamine | 207740-24-7 | 2A-9055413 |
| 2,3,4-Trifluorocinnamic acid | 207742-85-6 | 2A-9055417 |
| Mitiglinide calcium | 207844-01-7 | 2A-9055421 |
| Chloro-N,N,N',N'-tetramethylformamidinium hexafluorophosphate | 207915-99-9 | 2A-9055424 |
| 2',3',6'-Trifluoroacetophenone | 208173-22-2 | 2A-9055434 |
| 2,4-O-(3,4-Dimethylbenzylidene)-D-sorbitol | 208462-99-1 | 2A-9055440 |
| Mesosulfuron-methyl | 208465-21-8 | 2A-9055441 |
| 4-(1H-Pyrazol-5-yl)benzoic acid | 208511-67-5 | 2A-9055442 |
| 4-Chloroquinazolin-6-ylamine | 208533-37-3 | 2A-9055445 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA