
CAS Number31603-77-7
Synonymsbiphenyl-4-yl-acetonitrile; 4-CYANOMETHYLBIPHENYL; MFCD00016403; p-Biphenylylacetonitrile; [1,1'-Biphenyl]-4-acetonitrile; 4-Cyanomethyldiphenyl; 4-Biphenylylacetonitrile; p-Biphenylacetonitrile; 4-Biphenyl-Acetonitrile; 2-([1,1'-Biphenyl]-4-yl)acetonitrile; biphenylylacetonitrile; Biphenyl-4-ylacetonitrile; 4-Phenylphenylacetonitrile; Biphenyl-4-yl-acetonitril
Molecular FormulaC14H11N
Molecular Weight193.244
Purity98%
Density1.1±0.1 g/cm3
Boiling Point356.3±21.0 °C at 760 mmHg
Melting Point88-92 °C(lit.)
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 31603-77-7 |
| Catalog No. | 2A-9005267 |
| Chinese Name | 4-联苯乙腈 |
| Synonyms | biphenyl-4-yl-acetonitrile; 4-CYANOMETHYLBIPHENYL; MFCD00016403; p-Biphenylylacetonitrile; [1,1'-Biphenyl]-4-acetonitrile; 4-Cyanomethyldiphenyl; 4-Biphenylylacetonitrile; p-Biphenylacetonitrile; 4-Biphenyl-Acetonitrile; 2-([1,1'-Biphenyl]-4-yl)acetonitrile; biphenylylacetonitrile; Biphenyl-4-ylacetonitrile; 4-Phenylphenylacetonitrile; Biphenyl-4-yl-acetonitril |
| Molecular Formula | C14H11N |
| Molecular Weight | 193.244 |
| Purity | 98 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 356.3±21.0 °C at 760 mmHg |
| Melting Point | 88-92 °C(lit.) |
| Storage Condition | Keep the receptacle sealed, stored in a cool, dry |
| Packaging | III |
| HTC | 2926909090 |
| SMILES | N#CCc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C14H11N/c15-11-10-12-6-8-14(9-7-12)13-4-2-1-3-5-13/h1-9H,10H2 |
| InChI Key | HSZCNGTZJWZAMF-UHFFFAOYSA-N |
| Hazard Symbols | 6.1 |
| MSDS | msds/5267_2_31603_77_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 95.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Benzyloxyphenylacetic acid ethyl ester | 56441-69-1 | 2A-9005259 |
| 4-Benzyloxyphenylacetic acid methyl ester | 68641-16-7 | 2A-9005260 |
| 4-Benzyloxyphenylacetonitrile | 838-96-0 | 2A-9005261 |
| 4-Benzyloxyphenylisocyanide | 356533-74-9 | 2A-9005262 |
| 4-Biphenyl-[1,3]dioxol-5-yl-acetic acid | 2A-105265 | 2A-9005265 |
| 4-Bromo(trifluoromethoxy)benzene | 407-14-7 | 2A-9005271 |
| 4-Bromo-1,1,2-trifluorobut-1-ene | 10493-44-4 | 2A-9005273 |
| 4-Bromo-1,2-(methylenedioxy)benzene | 2635-13-4 | 2A-9005274 |
| 4-Bromo-1-butanol | 33036-62-3 | 2A-9005276 |
| 4-Bromo-1-butene | 5162-44-7 | 2A-9005277 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA