
CAS Number68641-16-7
SynonymsMFCD00157061; methyl 2-[4-(benzyloxy)benzyl]acetate; 4-Benzyloxyphenylacetic acid methyl ester; methyl 2-(4-(benzyloxy)phenyl)acetate; Methyl 4-benzyloxyphenylacetate; Methyl <p-(Benzyloxy)phenyl>acetate
Molecular FormulaC16H16O3
Molecular Weight256.29600
Purity95%
Density1.129g/cm3
Boiling Point375ºC at 760 mmHg
Melting Point53ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 68641-16-7 |
| Catalog No. | 2A-9005260 |
| Chinese Name | 4-苄氧基苯乙酸甲酯 |
| Synonyms | MFCD00157061; methyl 2-[4-(benzyloxy)benzyl]acetate; 4-Benzyloxyphenylacetic acid methyl ester; methyl 2-(4-(benzyloxy)phenyl)acetate; Methyl 4-benzyloxyphenylacetate; Methyl <p-(Benzyloxy)phenyl>acetate |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.29600 |
| Purity | 95 |
| Density | 1.129g/cm3 |
| Boiling Point | 375ºC at 760 mmHg |
| Melting Point | 53ºC |
| Storage Condition | 2~8℃ |
| HTC | 2918990090 |
| SMILES | COC(=O)Cc1ccc(OCc2ccccc2)cc1 |
| InChI Key | OUWFDISHMBDYON-UHFFFAOYSA-N |
| MSDS | msds/5260_1_68641_16_7.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Benzyloxychlorobenzene | 7700-27-8 | 2A-9005251 |
| 4-Benzyloxyfluorobenzene | 370-78-5 | 2A-9005253 |
| 4-Benzyloxyiodobenzene | 19578-68-8 | 2A-9005256 |
| 4-Benzyloxyphenylacetic acid | 6547-53-1 | 2A-9005258 |
| 4-Benzyloxyphenylacetic acid ethyl ester | 56441-69-1 | 2A-9005259 |
| 4-Benzyloxyphenylacetonitrile | 838-96-0 | 2A-9005261 |
| 4-Benzyloxyphenylisocyanide | 356533-74-9 | 2A-9005262 |
| 4-Biphenyl-[1,3]dioxol-5-yl-acetic acid | 2A-105265 | 2A-9005265 |
| 4-Biphenylacetonitrile | 31603-77-7 | 2A-9005267 |
| 4-Bromo(trifluoromethoxy)benzene | 407-14-7 | 2A-9005271 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA