
CAS Number134030-21-0
SynonymsN,N'-Dimesityl-1,2-ethanediamine; N,N'-bis(2,4,6-trimethylphenylamino)ethane; N1,N2-Dimesitylethane-1,2-diamine; N,N'-bis(mesityl)ethylenediamine; 1,2-bis(2,4,6-trimethylphenylamino)ethane; N,N'-(2,4,6-trimethylphenyl)ethylenediamine; UPCMLD00WV-78
Molecular FormulaC20H28N2
Molecular Weight296.450
Purity98.00%
Density1.0±0.1 g/cm3
Boiling Point471.5±33.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 134030-21-0 |
| Catalog No. | 2A-9052324 |
| Chinese Name | N,N'-二(2,4,6-三甲基苯基)乙二胺 |
| Synonyms | N,N'-Dimesityl-1,2-ethanediamine; N,N'-bis(2,4,6-trimethylphenylamino)ethane; N1,N2-Dimesitylethane-1,2-diamine; N,N'-bis(mesityl)ethylenediamine; 1,2-bis(2,4,6-trimethylphenylamino)ethane; N,N'-(2,4,6-trimethylphenyl)ethylenediamine; UPCMLD00WV-78 |
| Molecular Formula | C20H28N2 |
| Molecular Weight | 296.450 |
| Purity | 98.00 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 471.5±33.0 °C at 760 mmHg |
| Storage Condition | Room temperature, protected from light, stored in |
| HTC | 2921290000 |
| SMILES | Cc1cc(C)c(NCCNc2c(C)cc(C)cc2C)c(C)c1 |
| InChI Key | RQXQQXIIAQTDHU-UHFFFAOYSA-N |
| MSDS | msds/52324_1_134030_21_0.pdf |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2921290000 other acyclic polyamines and their derivatives; salts thereof. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Epoxiconazol | 133855-98-8 | 2A-9052309 |
| Ralfinamide | 133865-88-0 | 2A-9052311 |
| Safinamide | 133865-89-1 | 2A-9052312 |
| 2,2'-(Hydroxyimino)bisethanesulfonic acid disodium | 133986-51-3 | 2A-9052319 |
| Styrylethyltrimethoxysilane | 134000-44-5 | 2A-9052320 |
| N,N'-Bis(2,6-diisopropylphenyl)ethylenediamine | 134030-22-1 | 2A-9052325 |
| 2-[2-[2-Chloro-3-[2-(1,3-dihydro-1,1,3-trimethyl-2H-benz[e]indol-2-ylidene)ethylidene]-1-cyclohexen-1-yl]ethenyl]-1,1,3-trimethyl-1H-benz[e]indolium salt with 4-methylbenzenesulfonate (1:1) | 134127-48-3 | 2A-9052334 |
| 1-Amino-11-azido-3,6,9-trioxaundecane | 134179-38-7 | 2A-9052337 |
| Seocalcitol | 134404-52-7 | 2A-9052345 |
| 2-Bromo-5-nitrobenzonitrile | 134604-07-2 | 2A-9052361 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA