
CAS Number129322-83-4
SynonymsMFCD00061193; 1-(2,4,5-Trifluorophenyl)-1-ethanone; 1-Acetyl-2,4,5-trifluorobenzene; 1-(2,4,5-Trifluorophenyl)ethanone; FR BF DF EV1
Molecular FormulaC8H5F3O
Molecular Weight127.10
Purity99%
Density1.3±0.1 g/cm3
Boiling Point199.8±35.0 °C at 760 mmHg
Melting Point251-255 °C (lit.)
Appearancepowder
EINECS211-790-3
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 129322-83-4 |
| Catalog No. | 2A-9051959 |
| Chinese Name | 2',4',5'-三氟苯乙酮 |
| Synonyms | MFCD00061193; 1-(2,4,5-Trifluorophenyl)-1-ethanone; 1-Acetyl-2,4,5-trifluorobenzene; 1-(2,4,5-Trifluorophenyl)ethanone; FR BF DF EV1 |
| Molecular Formula | C8H5F3O |
| Molecular Weight | 127.10 |
| Purity | 99 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 199.8±35.0 °C at 760 mmHg |
| Melting Point | 251-255 °C (lit.) |
| Appearance | powder |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| EINECS | 211-790-3 |
| HTC | 2914700090 |
| PubChem ID | 24848270 |
| MDL Number | MFCD00151322 |
| SMILES | Cc1ncc([nH]1)[N+]([O-])=O |
| InChI | 1S/C4H5N3O2/c1-3-5-2-4(6-3)7(8)9/h2H,1H3,(H,5,6) |
| InChI Key | FFYTTYVSDVWNMY-UHFFFAOYSA-N |
| Beilstein/REAXYS | 4032 |
| NACRES Code | NA.22 |
| UNSPSC | 12352005 |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Loteprednol | 129260-79-3 | 2A-9051949 |
| (1,2,3,4-Tetrahydronaphthalen-2-yl)methanamine | 129280-17-7 | 2A-9051951 |
| Bis(4-methacryloylthiophenyl) sulfide | 129283-82-5 | 2A-9051952 |
| AGM-1470 | 129298-91-5 | 2A-9051956 |
| Ganirelix | 129311-55-3 | 2A-9051957 |
| tert-Butyl (E)-3,5-dihydroxy-7-[3'-(4''-fluorophenyl)-1'-methylethyl-indol-2'-yl]-6-heptenoate | 129332-29-2 | 2A-9051960 |
| Fenal | 129332-30-5 | 2A-9051961 |
| trans-(+/-)-11-Chloro-2,3,3a,12b-tetrahydro-2-methyl-1H-dibenz[2,3:6,7]oxepino[4,5-c]pyrrol-1-one | 129385-59-7 | 2A-9051962 |
| Verteporfin | 129497-78-5 | 2A-9051972 |
| Tolfenpyrad | 129558-76-5 | 2A-9051976 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA