CAS Number128388-54-5
Synonyms5'-m-Terphenylboronic Acid; 1,1':3',1''-Terphenyl-5'-ylboronic acid; (3,5-Diphenylphenyl)Boronic Acid; 1,1':3',1''-Terphenyl-5'-boronic acid
Molecular FormulaC18H15O2B1
Molecular Weight274.13
Purity98.00%
Density1.2±0.1 g/cm3
Boiling Point513.0±60.0 °C at 760 mmHg
Melting Point292-296ºC
AppearanceSolid;White to Almost white powder to crystal
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 128388-54-5 |
| Catalog No. | 2A-9051894 |
| Chinese Name | [1,1'：3',1''-三联苯] -5'-基硼酸 |
| Synonyms | 5'-m-Terphenylboronic Acid; 1,1':3',1''-Terphenyl-5'-ylboronic acid; (3,5-Diphenylphenyl)Boronic Acid; 1,1':3',1''-Terphenyl-5'-boronic acid |
| Molecular Formula | C18H15O2B1 |
| Molecular Weight | 274.13 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 513.0±60.0 °C at 760 mmHg |
| Melting Point | 292-296ºC |
| Appearance | Solid;White to Almost white powder to crystal |
| Water Solubility | Insoluble in water. |
| Storage Condition | room temperature |
| HTC | 2931900090 |
| MDL Number | MFCD09953491 |
| SMILES | OB(O)c1cc(-c2ccccc2)cc(-c2ccccc2)c1 |
| InChI Key | MRBZYVMZUBUDAX-UHFFFAOYSA-N |
| MSDS | msds/51894_1_128388_54_5.pdf |
| Tax Rebate | 13.0% |
| Supervision | AB (Inbound cargo customs clearance form) |
| Transport Info | Product name: Purity: 95.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified 5'-m-terphenylboronic acid (containing varying amounts of anhydride) Modification number: 5 |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2-Methoxy-5-methylphenylboronic acid | 127972-00-3 | 2A-9051860 |
| 2-Methoxy-5-formylphenylboronic acid | 127972-02-5 | 2A-9051861 |
| N-Ethyl-N-ethoxylethyl-4-amino-2-methyl benzaldehyde | 128237-47-8 | 2A-9051880 |
| 4-Formylphenylboronic acid pinacol cyclic ester | 128376-64-7 | 2A-9051892 |
| 4-(5,5-Dimethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde | 128376-65-8 | 2A-9051893 |
| Methyl 2-bromo-4-bromomethylbenzoate | 128577-48-0 | 2A-9051913 |
| 2-Chloroquinoline-3-boronic acid | 128676-84-6 | 2A-9051924 |
| 6-Fluoro-3,4-dihydro-2H-1-benzopyran-2-carboxylic acid | 129050-20-0 | 2A-9051941 |
| Milbemycin oxime | 129496-10-2 | 2A-9051971 |
| 3-Thiophen-3-ylbenzaldehyde | 129746-42-5 | 2A-9051988 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS